CAS 335165-68-9
:1-(3,6-dibromo-9H-carbazol-9-yl)-3-piperazin-1-ylpropan-2-ol dihydrochloride
Description:
1-(3,6-dibromo-9H-carbazol-9-yl)-3-piperazin-1-ylpropan-2-ol dihydrochloride is a chemical compound characterized by its complex structure, which includes a carbazole moiety and a piperazine ring. The presence of bromine atoms in the carbazole structure contributes to its potential biological activity and lipophilicity. This compound is typically a white to off-white solid and is soluble in polar solvents, which is common for dihydrochloride salts. The piperazine group enhances its pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychiatric disorders. The dihydrochloride form indicates that the compound is a salt, which can influence its stability and solubility profile. Its molecular interactions may involve hydrogen bonding and π-π stacking due to the aromatic nature of the carbazole. Overall, this compound's unique structural features suggest potential applications in drug development, although specific biological activities would require further investigation through experimental studies.
Formula:C19H23Br2Cl2N3O
InChI:InChI=1/C19H21Br2N3O.2ClH/c20-13-1-3-18-16(9-13)17-10-14(21)2-4-19(17)24(18)12-15(25)11-23-7-5-22-6-8-23;;/h1-4,9-10,15,22,25H,5-8,11-12H2;2*1H
SMILES:c1cc2c(cc1Br)c1cc(ccc1n2CC(CN1CCNCC1)O)Br.Cl.Cl
Synonyms:- 1-(3,6-Dibromo-9H-carbazol-9-yl)-3-(piperazin-1-yl)propan-2-ol dihydrochloride
- 1-(3,6-dibromo-9H-carbazol-9-yl)-3-piperazinopropan-2-ol dihydrochloride
- 9H-Carbazole-9-ethanol, 3,6-dibromo-alpha-(1-piperazinylmethyl)-, hydrochloride (1:2)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3,6-DIBROMO-α-(1-PIPERAZINYLMETHYL)-9H-CARBAZOLE-9-ETHANOL DIHYDROCHLORIDE
CAS:Formula:C19H21Br2N3OPurity:97%Color and Shape:SolidMolecular weight:467.1975BAI1
CAS:BAI1 (Bax channel blocker) is a potent inhibitor of Bax-mediated mitochondrial cytochrome C release (IC50: 0.52 μM).Formula:C19H21Br2N3OPurity:99.96% - >99.99%Color and Shape:SolidMolecular weight:467.21-(3,6-dibromo-9H-carbazol-9-yl)-3-(piperazin-1-yl)propan-2-ol
CAS:1-(3,6-Dibromo-9H-carbazol-9-yl)-3-(piperazin-1-yl)propan-2-ol is a fluorescent compound that absorbs radiation energy and emits light. It is used in diagnostic tests to detect the presence of bacteria, such as Mycobacterium tuberculosis. The light signal emitted by 1-(3,6-Dibromo-9H-carbazol-9-yl)-3-(piperazin-1-yl)propan-2-ol is proportional to the number of bacteria present and can be detected with a spectrometer or collimator. This analog can also be used as a marker for monolayers and plates in electron microscopy experiments.Formula:C19H21Br2N3OPurity:Min. 95%Molecular weight:467.2 g/mol



