![3'-butoxy-6'-hydroxy-spiro[isobenzofuran-3,9'-xanthene]-1-one](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F374617-3-butoxy-6-hydroxy-spiro-isobenzofuran-39-xanthene-1-one.webp&w=3840&q=75)
CAS 335193-91-4
:3'-butoxy-6'-hydroxy-spiro[isobenzofuran-3,9'-xanthene]-1-one
Description:
3'-Butoxy-6'-hydroxy-spiro[isobenzofuran-3,9'-xanthene]-1-one, identified by its CAS number 335193-91-4, is a synthetic organic compound characterized by its unique spirocyclic structure, which combines elements of isobenzofuran and xanthene. This compound features a butoxy group and a hydroxy group, contributing to its solubility and potential reactivity. The presence of the hydroxy group suggests that it may exhibit hydrogen bonding capabilities, influencing its physical properties and interactions with other molecules. The spiro structure often imparts rigidity to the molecule, which can affect its optical and electronic properties, making it of interest in various applications, including organic electronics and fluorescent materials. Additionally, the compound's unique structure may confer specific biological activities, warranting further investigation in pharmacological contexts. Overall, 3'-butoxy-6'-hydroxy-spiro[isobenzofuran-3,9'-xanthene]-1-one represents a fascinating example of synthetic organic chemistry with potential utility in multiple fields.
Formula:C24H20O5
InChI:InChI=1/C24H20O5/c1-2-3-12-27-16-9-11-20-22(14-16)28-21-13-15(25)8-10-19(21)24(20)18-7-5-4-6-17(18)23(26)29-24/h4-11,13-14,25H,2-3,12H2,1H3
SMILES:CCCCOc1ccc2c(c1)Oc1cc(ccc1C12c2ccccc2C(=O)O1)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
