CAS 33522-14-4

1-Benzo[1,3]dioxol-5-yl-cyclopropanecarbonitrile

Description:

1-Benzo[1,3]dioxol-5-yl-cyclopropanecarbonitrile, identified by its CAS number 33522-14-4, is a chemical compound characterized by its unique structural features, which include a benzo[1,3]dioxole moiety and a cyclopropanecarbonitrile group. The presence of the benzo[1,3]dioxole ring contributes to its aromatic properties and potential for engaging in various chemical reactions, while the cyclopropanecarbonitrile portion introduces a three-membered ring structure that can exhibit strain and reactivity. This compound may possess interesting biological activities, making it a subject of interest in medicinal chemistry and drug development. Its physical properties, such as solubility, melting point, and boiling point, would depend on the specific interactions of its functional groups and overall molecular structure. Additionally, the nitrile functional group can participate in nucleophilic addition reactions, further expanding its potential applications in organic synthesis. Overall, 1-Benzo[1,3]dioxol-5-yl-cyclopropanecarbonitrile represents a versatile compound with implications in various fields of chemistry.

Formula: C₁₁H₉NO₂

InChI: InChI=1/C11H9NO2/c12-6-11(3-4-11)8-1-2-9-10(5-8)14-7-13-9/h1-2,5H,3-4,7H2

SMILES: c1cc2c(cc1C1(CC1)C#N)OCO2

Synonyms:

• 1-(1,3-Benzodioxol-5-yl)cyclopropanecarbonitrile
• Cyclopropanecarbonitrile, 1-(1,3-Benzodioxol-5-Yl)-
• 1-Benzo[1,3]dioxol-5-yl-cyclopropanecarbonitrile

1-(Benzo[d][1,3]dioxol-5-yl)cyclopropanecarbonitrile

CAS: 33522-14-4

Formula: C₁₁H₉NO₂

Molecular weight: 187.1947

Ref: IN-DA00CKRX

1-(1,3-Benzodioxol-5-yl)cyclopropanecarbonitrile

CAS: 33522-14-4

Versatile small molecule scaffold

Formula: C₁₁H₉NO₂

Purity: Min. 95%

Molecular weight: 187.19 g/mol

Ref: 3D-IBA52214