CAS 3354-82-3

2,4,6-tribromobenzene-1,3,5-triol

Description:

2,4,6-Tribromobenzene-1,3,5-triol, with the CAS number 3354-82-3, is a brominated aromatic compound characterized by the presence of three bromine atoms and three hydroxyl (–OH) groups attached to a benzene ring. This compound exhibits a high degree of bromination, which significantly influences its chemical properties, including increased reactivity and potential for forming hydrogen bonds due to the hydroxyl groups. The presence of multiple bromine substituents typically enhances the compound's hydrophobicity and may impart biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. Additionally, the triol structure suggests potential applications in polymer chemistry and as a flame retardant. The compound's solubility is likely limited in water due to its hydrophobic characteristics, but it may dissolve in organic solvents. Safety considerations are important when handling this compound, as brominated compounds can pose environmental and health risks. Overall, 2,4,6-tribromobenzene-1,3,5-triol is a complex molecule with diverse potential applications and implications in chemical research.

Formula: C₆H₃Br₃O₃

InChI: InChI=1/C6H3Br3O3/c7-1-4(10)2(8)6(12)3(9)5(1)11/h10-12H

SMILES: c1(c(c(c(c(c1O)Br)O)Br)O)Br

Synonyms:

• 1,3,5-Benzenetriol, 2,4,6-Tribromo-
• 2,4,6-Tribromobenzene-1,3,5-triol

1,3,5-Benzenetriol, 2,4,6-tribromo-

CAS: 3354-82-3

Formula: C₆H₃Br₃O₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 362.7982

Ref: IN-DA00I6LX

2,4,6-Tribromobenzene-1,3,5-Triol

CAS: 3354-82-3

2,4,6-Tribromobenzene-1,3,5-Triol

Purity: 99%

Molecular weight: 362.8g/mol

Ref: 54-OR1025017

2,4,6-tribromobenzene-1,3,5-triol

CAS: 3354-82-3

2,4,6-tribromobenzene-1,3,5-triol

Purity: ≥98%

Molecular weight: 362.8g/mol

Ref: 54-BUP13558

2,4,6-tribromobenzene-1,3,5-triol

CAS: 3354-82-3

2,4,6-tribromobenzene-1,3,5-triol (1,3,5-Benzenetriol, 2,4,6-tribromo- (9CI)) is a marine derived natural products found in Rhabdonia verticillata.

Formula: C₆H₃Br₃O₃

Purity: 99.66%

Color and Shape: Solid

Molecular weight: 362.8

Ref: TM-TN7171

2,4,6-Tribromobenzene-1,3,5-triol

CAS: 3354-82-3

Formula: C₆H₃Br₃O₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 362.799

Ref: 10-F375698