CAS 33557-57-2
:3-Methylpiperidin-4-ol
Description:
3-Methylpiperidin-4-ol is a cyclic organic compound characterized by a piperidine ring with a methyl group at the third position and a hydroxyl group at the fourth position. This compound is a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is soluble in water and various organic solvents, making it versatile in chemical applications. The presence of the hydroxyl group contributes to its potential as a nucleophile in chemical reactions, while the piperidine structure provides basic properties. 3-Methylpiperidin-4-ol is often utilized in the synthesis of pharmaceuticals and agrochemicals, as well as in the development of various chemical intermediates. Its reactivity can be influenced by the functional groups present, allowing for a range of chemical transformations. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if ingested or inhaled. Proper safety protocols should be followed when working with this substance in laboratory or industrial settings.
Formula:C6H13NO
InChI:InChI=1/C6H13NO/c1-5-4-7-3-2-6(5)8/h5-8H,2-4H2,1H3
SMILES:CC1CNCCC1O
Synonyms:- 4-Piperidinol, 3-Methyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4-Hydroxy-3-methylpiperidine
CAS:<p>4-Hydroxy-3-methylpiperidine (4HMPD) is a heterocyclic compound that has shown to be a potent inhibitor of influenza virus. 4HMPD can be used as a drug to treat influenza in humans because it has the ability to inhibit the replication of human influenza viruses and is not toxic to humans. 4HMPD targets the influenza virus by binding to the viral nucleoprotein and inhibiting its function. The molecular structure of 4HMPD is similar to that of piperidine, which is an amino acid found in proteins. This similarity may help explain why 4HMPD inhibits influenza virus replication because amino acids are necessary for protein synthesis.</p>Formula:C6H14ClNOPurity:Min. 95%Molecular weight:151.64 g/mol


