CAS 3356-88-5
:3-(2-Hydroxyethyl)-2-oxazolidinone
Description:
3-(2-Hydroxyethyl)-2-oxazolidinone, also known as HEOD, is a cyclic amide characterized by its five-membered ring structure containing both an oxazolidinone moiety and a hydroxyethyl substituent. This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It is soluble in water and various organic solvents, which enhances its utility in different applications. The presence of the hydroxyethyl group contributes to its hydrophilicity and potential reactivity, making it useful in the synthesis of polymers and as a building block in organic chemistry. Additionally, 3-(2-Hydroxyethyl)-2-oxazolidinone exhibits low toxicity, which is advantageous for its use in pharmaceuticals and cosmetic formulations. Its chemical stability and ability to participate in various chemical reactions, such as esterification and amidation, further expand its applicability in industrial processes. Overall, this compound is valued for its versatility and functional properties in both research and commercial settings.
Formula:C5H9NO3
InChI:InChI=1S/C5H9NO3/c7-3-1-6-2-4-9-5(6)8/h7H,1-4H2
InChI key:InChIKey=GOXNUYXRIQJIEF-UHFFFAOYSA-N
SMILES:C(CO)N1C(=O)OCC1
Synonyms:- 2-(2-Oxo-1,3-oxazolidin-3-yl)ethanol
- 2-Oxazolidinone, 3-(2-hydroxyethyl)-
- 3-(2-Hydroxyethyl)-1,3-Oxazolidin-2-One
- 3-(Hydroxyethyl)-2-oxazolidone
- Ai3-34576
- Brn 0115749
- N-(2-Hydroxyethyl)oxazolidin-2-one
- N-Hydroxyethyl-2-oxazolidone
- Nsc 57598
- 3-(2-Hydroxyethyl)-2-oxazolidinone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-(2-Hydroxyethyl)oxazolidin-2-one
CAS:Formula:C5H9NO3Purity:90.0%Color and Shape:LiquidMolecular weight:131.12993-(2-Hydroxyethyl)-1,3-oxazolidin-2-one
CAS:3-(2-Hydroxyethyl)-1,3-oxazolidin-2-onePurity:95%Molecular weight:131.13g/mol3-(2-Hydroxyethyl)oxazolidin-2-one
CAS:Formula:C5H9NO3Purity:>90.0%(GC)Color and Shape:Colorless to Light yellow clear liquidMolecular weight:131.133-(2-Hydroxyethyl)-1,3-oxazolidin-2-one
CAS:Formula:C5H9NO3Purity:94.0%Color and Shape:Liquid, ClearMolecular weight:131.1313-(2-Hydroxyethyl)-1,3-oxazolidin-2-one
CAS:3-(2-Hydroxyethyl)-1,3-oxazolidin-2-one is a synthetic compound that is used as an antioxidant and antibacterial agent. The chemical has been shown to be effective against a wide range of microorganisms, including bacteria, fungi, and viruses. 3-(2-Hydroxyethyl)-1,3-oxazolidin-2-one inhibits bacterial growth by modifying the cell membrane and disrupting the cell wall. This compound also has been found to react with amines in proteins, which may account for its antimicrobial activity. 3-(2-Hydroxyethyl)-1,3-oxazolidin-2-one reacts with oxygen to form hydroxyl radicals that can attack the lipid membrane of cells. It also reacts with piperazine in a reaction that produces nitric oxide radicals and hydrogen peroxide. This process can lead to oxidative carbonylation of polymers such as polypropylene or polyvinyl chloride (PVCFormula:C5H9NO3Purity:Min. 95%Molecular weight:131.13 g/mol




