CAS 3356-89-6

5-chloro-3-phenyl-1,2-oxazole

Description:

5-Chloro-3-phenyl-1,2-oxazole is a heterocyclic organic compound characterized by the presence of both an oxazole ring and a phenyl group. The oxazole ring consists of a five-membered aromatic structure containing one nitrogen and one oxygen atom, contributing to its unique chemical properties. The chlorine substituent at the 5-position enhances its reactivity and can influence its biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its structure allows for potential applications in pharmaceuticals, agrochemicals, and materials science, particularly due to the presence of the phenyl group, which can facilitate interactions with biological targets. Additionally, the compound may exhibit interesting optical and electronic properties, making it a subject of interest in research. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 5-chloro-3-phenyl-1,2-oxazole is a versatile compound with significant implications in various fields of chemistry.

Formula: C₉H₆ClNO

InChI: InChI=1/C9H6ClNO/c10-9-6-8(11-12-9)7-4-2-1-3-5-7/h1-6H

SMILES: c1ccc(cc1)c1cc(Cl)on1

Synonyms:

• 3-Phenyl-5-chloroisoxazole
• Isoxazole, 5-chloro-3-phenyl-

5-chloro-3-phenyl-oxazole

CAS: 3356-89-6

Formula: C₉H₆ClNO

Purity: 98%

Color and Shape: Solid

Molecular weight: 179.6030

Ref: IN-DA00CLMI

5-Chloro-3-phenylisoxazole

CAS: 3356-89-6

5-Chloro-3-phenylisoxazole

Purity: 98%

Molecular weight: 179.60g/mol

Ref: 54-OR86381

5-Chloro-3-phenylisoxazole

CAS: 3356-89-6

Formula: C₉H₆ClNO

Purity: 98%

Color and Shape: Solid

Molecular weight: 179.6

Ref: 10-F340226

5-Chloro-3-phenylisoxazole

CAS: 3356-89-6

5-Chloro-3-phenylisoxazole is a versatile compound with various applications. It has been widely used in research as a collagen cross-linking agent and in the synthesis of new compounds for drug development. Additionally, it has shown potential as an inhibitor of glycogen synthase kinase (GSK-3β), an enzyme involved in the regulation of cell signaling pathways.

Formula: C₉H₆ClNO

Purity: Min. 95%

Molecular weight: 179.6 g/mol

Ref: 3D-DAA35689