CAS 335654-08-5

2-chloro-5,7-dihydro-6H-pyrrolo[2,3-d]pyrimidin-6-one

Description:

2-Chloro-5,7-dihydro-6H-pyrrolo[2,3-d]pyrimidin-6-one is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyrimidine rings. This compound features a chlorine atom at the 2-position and a carbonyl group at the 6-position, contributing to its reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carbonyl group. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as similar compounds have been investigated for their roles as kinase inhibitors or in other therapeutic areas. Its molecular properties, such as melting point, boiling point, and spectral characteristics, would be essential for further characterization and application in research. Safety data should be consulted to understand its handling and potential hazards, as with any chemical substance.

Formula: C₆H₄ClN₃O

InChI: InChI=1/C6H4ClN3O/c7-6-8-2-3-1-4(11)9-5(3)10-6/h2H,1H2,(H,8,9,10,11)

SMILES: C1c2cnc(Cl)nc2N=C1O

Synonyms:

• 6H-Pyrrolo[2,3-d]pyrimidin-6-one, 2-chloro-5,7-dihydro-
• 2-Chloro-5H-Pyrrolo[2,3-D]Pyrimidin-6(7H)-One
• 2-Chloro-5,7-dihydro-6H-pyrrolo[2,3-d]pyrimidin-6-one

2-Chloro-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one

CAS: 335654-08-5

Formula: C₆H₄ClN₃O

Purity: 96%

Color and Shape: Solid

Molecular weight: 169.5685

Ref: IN-DA00I6M3

2-Chloro-5,7-dihydro-6H-pyrrolo[2,3-d]pyrimidin-6-one

CAS: 335654-08-5

2-Chloro-5,7-dihydro-6H-pyrrolo[2,3-d]pyrimidin-6-one

Purity: 98%

Molecular weight: 169.57g/mol

Ref: 54-OR301236

2-Chloro-5H-pyrrolo[2,3-d]pyrimidin-6(7H)-one

CAS: 335654-08-5

Purity: 96%

Molecular weight: 169.57

Ref: 10-F016250