
CAS 33582-68-2
:1,1-Cyclobutanedicarboxamide
Description:
1,1-Cyclobutanedicarboxamide, with the CAS number 33582-68-2, is an organic compound characterized by its cyclic structure and the presence of two carboxamide functional groups. This compound features a cyclobutane ring, which consists of four carbon atoms arranged in a square planar configuration, with two amide groups (-CONH2) attached to the first carbon atom. The presence of these functional groups imparts specific chemical properties, such as the ability to form hydrogen bonds, which can influence its solubility and reactivity. Typically, compounds like 1,1-Cyclobutanedicarboxamide may exhibit moderate polarity, making them soluble in polar solvents. The compound's structure suggests potential applications in organic synthesis and materials science, particularly in the development of polymers or as intermediates in chemical reactions. Additionally, the presence of amide groups may confer biological activity, making it of interest in medicinal chemistry. Overall, 1,1-Cyclobutanedicarboxamide is a versatile compound with unique structural features that can lead to various chemical behaviors and applications.
Formula:C6H10N2O2
InChI:InChI=1S/C6H10N2O2/c7-4(9)6(5(8)10)2-1-3-6/h1-3H2,(H2,7,9)(H2,8,10)
InChI key:InChIKey=VEQSYQFANVTOGA-UHFFFAOYSA-N
SMILES:C(N)(=O)C1(C(N)=O)CCC1
Synonyms:- NSC 147623
- 1,1-Cyclobutanedicarboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.


