CAS 33588-54-4
:1-[3-(Acetyloxy)-5-bromo-1H-indol-1-yl]ethanone
Description:
1-[3-(Acetyloxy)-5-bromo-1H-indol-1-yl]ethanone, with the CAS number 33588-54-4, is a chemical compound that belongs to the indole family, characterized by the presence of an indole ring structure. This compound features a bromine atom and an acetyloxy group, which contribute to its unique chemical properties and reactivity. The presence of the acetyloxy group suggests that it may participate in various chemical reactions, such as esterification or nucleophilic substitution. The bromine atom can also serve as a site for further functionalization, making it a versatile intermediate in organic synthesis. This compound may exhibit biological activity, potentially influencing various biochemical pathways, which is common for indole derivatives. Its solubility, stability, and reactivity can vary depending on the solvent and conditions used. Overall, 1-[3-(Acetyloxy)-5-bromo-1H-indol-1-yl]ethanone is of interest in both synthetic organic chemistry and medicinal chemistry due to its structural features and potential applications.
Formula:C12H10BrNO3
InChI:InChI=1S/C12H10BrNO3/c1-7(15)14-6-12(17-8(2)16)10-5-9(13)3-4-11(10)14/h3-6H,1-2H3
InChI key:InChIKey=XJRIDJAGAYGJCK-UHFFFAOYSA-N
SMILES:O(C(C)=O)C=1C=2C(N(C(C)=O)C1)=CC=C(Br)C2
Synonyms:- (1-Acetyl-5-bromoindol-3-yl) acetate
- 1-Acetyl-5-bromoindol-3-ol acetate
- 1-[3-(Acetyloxy)-5-bromo-1H-indol-1-yl]ethanone
- 1-acetyl-5-bromo-1H-indol-3-yl acetate
- 1H-Indol-3-ol, 1-acetyl-5-bromo-, acetate (ester)
- 3-Acetoxy-1-acetyl-5-bromoindole
- Ethanone, 1-[3-(acetyloxy)-5-bromo-1H-indol-1-yl]-
- Indol-3-ol, 1-acetyl-5-bromo-, acetate (ester)
- Indoxyl, 1-acetyl-5-bromo-, acetate
- N-acetyl-5-bromoindolyl acetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
5-Bromoindoxyl diacetate, 98+%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C12H10BrNO3Purity:98+%Color and Shape:Powder, White to cream to yellowMolecular weight:296.125-Bromoindoxyl diacetate
CAS:Formula:C12H10BrNO3Purity:97%Color and Shape:SolidMolecular weight:296.11671-ACETYL-3-ACETYLOXY-5-BROMOINDOLE
CAS:Formula:C12H10BrNO3Purity:98%Color and Shape:SolidMolecular weight:296.125-Bromo-3-indoxyl-1,3-diacetate
CAS:5-Bromo-3-indoxyl-1,3-diacetate is a reaction component that is used in the synthesis of many complex compounds. It is a reagent that can be used to synthesize speciality chemicals and fine chemicals. This chemical is also a versatile building block that can be used as an intermediate or a building block in the synthesis of many complex compounds. The CAS No. 33588-54-4 identifies this compound as high quality and useful for research purposes.
Formula:C12H10BrNO3Molecular weight:296.13 g/mol





