CAS 33588-64-6

ethyl 2-indole acetate

Description:

Ethyl 2-indole acetate is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features an ethyl ester functional group attached to the indole moiety, contributing to its chemical properties. Ethyl 2-indole acetate is typically a colorless to pale yellow liquid with a pleasant, floral aroma, making it of interest in the fragrance and flavor industries. It is known for its potential applications in perfumery due to its sweet and slightly spicy scent profile. The compound is soluble in organic solvents, such as ethanol and ether, but has limited solubility in water. In terms of reactivity, it may undergo hydrolysis under acidic or basic conditions, leading to the release of indole and acetic acid. Additionally, ethyl 2-indole acetate may exhibit biological activity, which has prompted research into its potential uses in pharmaceuticals and agrochemicals. Overall, its unique structure and properties make it a compound of interest in various fields of chemistry and industry.

Formula: C₁₂H₁₃NO₂

InChI: InChI=1/C12H13NO2/c1-2-15-12(14)8-10-7-9-5-3-4-6-11(9)13-10/h3-7,13H,2,8H2,1H3

SMILES: CCOC(=O)Cc1cc2ccccc2[nH]1

Synonyms:

• 1H-indole-2-acetic acid, ethyl ester
• ethyl 1H-indol-2-ylacetate
• Ethyl Indole-2-Acetate

Ethyl indole-2-acetate

CAS: 33588-64-6

Formula: C₁₂H₁₃NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 203.2371

Ref: IN-DA00CAPE

Ethyl 1H-indol-2-ylacetate

CAS: 33588-64-6

Ethyl 1H-indol-2-ylacetate

Purity: 97%

Molecular weight: 203.23712g/mol

Ref: 54-OR200012

Ethyl 2-(1H-indol-2-yl)acetate

CAS: 33588-64-6

Formula: C₁₂H₁₃NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 203.241

Ref: 10-F093497