
CAS 33597-67-0
:1-(5-Methyl-3-furanyl)-1,2,3-propanetriol
Description:
1-(5-Methyl-3-furanyl)-1,2,3-propanetriol, with the CAS number 33597-67-0, is an organic compound characterized by its furan ring structure and a triol functional group. This compound features a five-membered furan ring substituted with a methyl group at the 5-position, contributing to its unique chemical properties. The presence of three hydroxyl (-OH) groups indicates that it is a triol, which enhances its solubility in water and its potential for hydrogen bonding. This triol structure can also influence its reactivity, making it a candidate for various chemical reactions, including esterification and etherification. The furan moiety may impart aromatic characteristics, potentially affecting its flavor and fragrance properties, which is relevant in food and cosmetic applications. Additionally, the compound's molecular structure suggests it may exhibit biological activity, although specific biological properties would require further investigation. Overall, this compound's unique structure and functional groups make it of interest in both synthetic chemistry and potential applications in various industries.
Formula:C8H12O4
InChI:InChI=1S/C8H12O4/c1-5-2-6(4-12-5)8(11)7(10)3-9/h2,4,7-11H,3H2,1H3
InChI key:InChIKey=LNQWSCLHWGILCZ-UHFFFAOYSA-N
SMILES:C(C(CO)O)(O)C=1C=C(C)OC1
Synonyms:- 1-(5-Methyl-3-furanyl)-1,2,3-propanetriol
- 1-(5-Methyl-3-furyl)glycerol
- 2-Methyl-4-(1-glyceryl)furan
- 1,2,3-Propanetriol, 1-(5-methyl-3-furanyl)-
- 1,2,3-Propanetriol, 1-(5-methyl-3-furyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-(5-Methyl-3-furanyl)-1,2,3-propanetriol
CAS:1-(5-Methyl-3-furanyl)-1,2,3-propanetriol is a useful organic compound for research related to life sciences.Formula:C8H12O4Color and Shape:SolidMolecular weight:172.18
