CAS 336-61-8

2,2,3,3,4,4,4-heptafluoro-N-phenylbutanamide

Description:

2,2,3,3,4,4,4-heptafluoro-N-phenylbutanamide, with the CAS number 336-61-8, is a fluorinated organic compound characterized by its unique structure that includes a phenyl group and multiple fluorine atoms. This compound is notable for its high degree of fluorination, which imparts significant chemical stability and hydrophobic properties. The presence of the amide functional group contributes to its potential as a polar solvent and its ability to engage in hydrogen bonding. Typically, such fluorinated compounds exhibit low volatility and high thermal stability, making them suitable for various applications in chemical synthesis and materials science. Additionally, the fluorine atoms enhance the compound's resistance to degradation and reactivity with other chemicals. Its specific properties, such as solubility and reactivity, can vary depending on the surrounding environment and the presence of other functional groups. Overall, 2,2,3,3,4,4,4-heptafluoro-N-phenylbutanamide is an interesting compound in the field of fluorinated chemicals, with potential applications in pharmaceuticals and advanced materials.

Formula: C₁₀H₆F₇NO

InChI: InChI=1/C10H6F7NO/c11-8(12,9(13,14)10(15,16)17)7(19)18-6-4-2-1-3-5-6/h1-5H,(H,18,19)

SMILES: c1ccc(cc1)N=C(C(C(C(F)(F)F)(F)F)(F)F)O

Synonyms:

• butanamide, 2,2,3,3,4,4,4-heptafluoro-N-phenyl-
• 2,2,3,3,4,4,4-Heptafluoro-N-phenylbutanamide

Heptafluorobutyranilide

Controlled Product

CAS: 336-61-8

Applications Heptafluorobutyranilide (cas# 336-61-8) is a compound useful in organic synthesis.

Formula: C₁₀H₆F₇NO

Color and Shape: Neat

Molecular weight: 289.15

Ref: TR-H281050

AI 3-18011

CAS: 336-61-8

AI 3-18011 is a biochemical.

Formula: C₁₀H₆F₇NO

Color and Shape: Solid

Molecular weight: 289.15

Ref: TM-T29758