CAS 33607-57-7
:rel-(3aR,6aS)-Tetrahydro-1,3-bis(phenylmethyl)-1H-thieno[3,4-d]imidazole-2,4-dione
Description:
Rel-(3aR,6aS)-Tetrahydro-1,3-bis(phenylmethyl)-1H-thieno[3,4-d]imidazole-2,4-dione, with CAS number 33607-57-7, is a chemical compound characterized by its unique bicyclic structure that incorporates both thieno and imidazole moieties. This compound features a tetrahydro configuration, indicating the presence of a saturated ring system, and is substituted with two phenylmethyl groups, which contribute to its lipophilicity and potential biological activity. The stereochemistry, denoted by the (3aR,6aS) notation, suggests specific spatial arrangements of its atoms, which can influence its interactions with biological targets. The imidazole and thieno rings are known for their roles in various pharmacological activities, making this compound of interest in medicinal chemistry. Its potential applications may include use as a pharmaceutical agent, although specific biological activities and mechanisms would require further investigation. Overall, the compound's structural features suggest it may exhibit interesting chemical reactivity and biological properties, warranting further research into its applications.
Formula:C19H18N2O2S
InChI:InChI=1/C19H18N2O2S/c22-18-17-16(13-24-18)20(11-14-7-3-1-4-8-14)19(23)21(17)12-15-9-5-2-6-10-15/h1-10,16-17H,11-13H2/t16-,17-/s2
InChI key:InChIKey=XJZIDYQGGLZUIO-RXQGYGPJNA-N
SMILES:C(N1[C@]2([C@@](N(CC3=CC=CC=C3)C1=O)(CSC2=O)[H])[H])C4=CC=CC=C4
Synonyms:- 1,3-dibenzyltetrahydro-1H-thieno[3,4-d]imidazole-2,4-dione
- 1H-Thieno[3,4-d]imidazole-2,4(3H,3aH)-dione, 1,3-dibenzyldihydro-, cis-(±)-
- 1H-Thieno[3,4-d]imidazole-2,4(3H,3aH)-dione, dihydro-1,3-bis(phenylmethyl)-, cis-(±)-
- 1H-Thieno[3,4-d]imidazole-2,4-dione, tetrahydro-1,3-bis(phenylmethyl)-, (3aR,6aS)-rel-
- cis-(1)-1,3-Dibenzyldihydro-1H-thieno(3,4-d)imidazole-2,4(3H,3aH)-dione
- cis-1,3-Dibenzylhexahydro-1H-thieno[3,4-d]imidazole-2,4-dione
- rel-(3aR,6aS)-Tetrahydro-1,3-bis(phenylmethyl)-1H-thieno[3,4-d]imidazole-2,4-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

