CAS 33609-48-2
:(3,4-dinitrophenyl)(phenyl)methanone
Description:
(3,4-Dinitrophenyl)(phenyl)methanone, with the CAS number 33609-48-2, is an organic compound characterized by its complex structure, which includes a phenyl group and a dinitrophenyl moiety attached to a carbonyl group. This compound typically exhibits a yellow crystalline appearance due to the presence of the dinitro substituents, which are known to impart strong electron-withdrawing properties. As a result, it may display significant reactivity, particularly in electrophilic aromatic substitution reactions. The presence of the dinitrophenyl group can also enhance the compound's ability to participate in various chemical reactions, making it useful in synthetic organic chemistry. Additionally, due to the nitro groups, this compound may exhibit explosive properties under certain conditions, necessitating careful handling and storage. Its applications may extend to areas such as analytical chemistry, where it can serve as a reagent for detecting amines or other nucleophiles. Overall, (3,4-dinitrophenyl)(phenyl)methanone is a notable compound in the realm of organic synthesis and chemical research.
Formula:C13H8N2O5
InChI:InChI=1/C13H8N2O5/c16-13(9-4-2-1-3-5-9)10-6-7-11(14(17)18)12(8-10)15(19)20/h1-8H
SMILES:c1ccc(cc1)C(=O)c1ccc(c(c1)N(=O)=O)N(=O)=O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(3,4-Dinitrophenyl)(phenyl-d5)methanone
CAS:Controlled Product<p>Applications (3,4-Dinitrophenyl)(phenyl-d5)methanone is an intermediate for the synthesis of Mebendazole-d8 (M200502), which is labelled Mebendazole (M200500). Anthelmintic (Nematodes).<br>References Al-Badr, A.A., et al.: Anal. Profiles Drug Subs., 16, 291 (1987)<br></p>Formula:C13D5H3N2O5Color and Shape:NeatMolecular weight:277.244
