
CAS 33611-85-7
:Folic acid tetraglutamate
Description:
Folic acid tetraglutamate, also known as tetra-glutamyl folate, is a polyglutamated form of folic acid, which is a water-soluble B-vitamin (B9) essential for various biological functions. This compound is characterized by its structure, which includes multiple glutamic acid residues attached to the folate molecule, enhancing its solubility and bioavailability in biological systems. Folic acid tetraglutamate plays a crucial role in DNA synthesis, repair, and methylation, making it vital for cell division and growth, particularly during periods of rapid growth such as pregnancy and infancy. It is also involved in the metabolism of amino acids and the formation of red blood cells. The compound is typically found in food sources such as leafy greens, legumes, and fortified cereals. In terms of stability, it is sensitive to heat and light, which can lead to degradation. Its CAS number, 33611-85-7, is used for identification in chemical databases and regulatory contexts. Overall, folic acid tetraglutamate is significant in nutrition and health, particularly in preventing neural tube defects during pregnancy.
Formula:C39H47N11O18
InChI:InChI=1S/C39H47N11O18/c40-39-49-31-30(33(58)50-39)43-19(16-42-31)15-41-18-3-1-17(2-4-18)32(57)48-24(38(67)68)8-13-28(54)46-22(36(63)64)6-11-26(52)44-20(34(59)60)5-10-25(51)45-21(35(61)62)7-12-27(53)47-23(37(65)66)9-14-29(55)56/h1-4,16,20-24,41H,5-15H2,(H,44,52)(H,45,51)(H,46,54)(H,47,53)(H,48,57)(H,55,56)(H,59,60)(H,61,62)(H,63,64)(H,65,66)(H,67,68)(H3,40,42,49,50,58)/t20-,21-,22-,23-,24-/m0/s1
InChI key:InChIKey=IVSPPVMFGMVDLI-LSBAASHUSA-N
SMILES:O=C1C=2C(NC=C(CNC3=CC=C(C(N[C@@H](CCC(N[C@@H](CCC(N[C@@H](CCC(N[C@@H](CCC(N[C@@H](CCC(O)=O)C(O)=O)=O)C(O)=O)=O)C(O)=O)=O)C(O)=O)=O)C(O)=O)=O)C=C3)N2)=NC(N)=N1
Synonyms:- L-Glutamic acid, N-[4-[[(2-amino-3,4-dihydro-4-oxo-6-pteridinyl)methyl]amino]benzoyl]-L-γ-glutamyl-L-γ-glutamyl-L-γ-glutamyl-L-γ-glutamyl-
- N-[4-[[(2-Amino-3,4-dihydro-4-oxo-6-pteridinyl)methyl]amino]benzoyl]-L-γ-glutamyl-L-γ-glutamyl-L-γ-glutamyl-L-γ-glutamyl-L-glutamic acid
- L-Glutamic acid, N-[4-[[(2-amino-1,4-dihydro-4-oxo-6-pteridinyl)methyl]amino]benzoyl]-L-γ-glutamyl-L-γ-glutamyl-L-γ-glutamyl-L-γ-glutamyl-
- Glutamic acid, N-[N-[N-[N-(N-pteroyl-L-γ-glutamyl)-L-γ-glutamyl]-L-γ-glutamyl]-L-γ-glutamyl]-, L-
- L-Glutamic acid, N-[N-[N-[N-[N-[4-[[(2-amino-1,4-dihydro-4-oxo-6-pteridinyl)methyl]amino]benzoyl]-L-γ-glutamyl]-L-γ-glutamyl]-L-γ-glutamyl]-L-γ-glutamyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Pteroylpentaglutamic acid
CAS:Pteroylpentaglutamic acid within the folic acid family is a bioactive chemical.Formula:C39H47N11O18Color and Shape:SolidMolecular weight:957.85
