CAS 336182-11-7: 2-Pyrrolidineacetic acid, 4-hydroxy-, hydrochloride (1:1), (2S,4R)-
Description:2-Pyrrolidineacetic acid, 4-hydroxy-, hydrochloride (1:1), (2S,4R)- is a chiral compound characterized by its pyrrolidine ring structure, which contributes to its biological activity. This substance features a carboxylic acid functional group and a hydroxyl group, enhancing its solubility in polar solvents and its potential for hydrogen bonding. The presence of the hydrochloride indicates that it is a salt form, which typically improves stability and solubility in aqueous solutions. The (2S,4R) designation refers to the specific stereochemistry of the molecule, which is crucial for its interaction with biological systems, particularly in pharmacology. This compound may exhibit properties relevant to medicinal chemistry, potentially influencing neurotransmitter systems or serving as a scaffold for drug development. Its unique structural features and stereochemistry make it a subject of interest in research related to pharmaceuticals and biochemistry. As with many compounds, safety and handling precautions should be observed, given its classification and potential biological activity.
Formula:C6H11NO3·ClH
InChI:InChI=1S/C6H11NO3.ClH/c8-5-1-4(7-3-5)2-6(9)10;/h4-5,7-8H,1-3H2,(H,9,10);1H/t4-,5+;/m0./s1
InChI key:InChIKey=YSPVOIKBQGMRKO-UYXJWNHNSA-N
SMILES:Cl.O=C(O)CC1NCC(O)C1
- Synonyms:
- 2-Pyrrolidineacetic acid, 4-hydroxy-, hydrochloride, (2S,4R)-
- 2-Pyrrolidineacetic acid, 4-hydroxy-, hydrochloride (1:1), (2S,4R)-
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | L-β-HOMOHYDROXYPROLINE HYDROCHLORIDE REF: IN-DA00C7TFCAS: 336182-11-7 | 97% | To inquire | Mon 07 Apr 25 |
 | 2-((2S,4R)-4-Hydroxypyrrolidin-2-yl)acetic acid hydrochloride REF: 10-F243345CAS: 336182-11-7 | 95.0% | To inquire | Tue 15 Apr 25 |
 | L-β-Homohydroxyproline hydrochloride REF: 3D-FH49712CAS: 336182-11-7 | Min. 95% | - - - | Discontinued product |
L-β-HOMOHYDROXYPROLINE HYDROCHLORIDE
Ref: IN-DA00C7TF
| 1g | To inquire | ||
| 25mg | 127.00 € | ||
| 100mg | 210.00 € | ||
| 250mg | 572.00 € |
2-((2S,4R)-4-Hydroxypyrrolidin-2-yl)acetic acid hydrochloride
Ref: 10-F243345
| 100mg | 138.00 € | ||
| 250mg | 318.00 € |
L-β-Homohydroxyproline hydrochloride
Ref: 3D-FH49712
| 5mg | Discontinued | Request information | |
| 10mg | Discontinued | Request information | |
| 25mg | Discontinued | Request information | |
| 50mg | Discontinued | Request information | |
| 100mg | Discontinued | Request information |
