
CAS 336185-27-4
:(1R)-6,7-diethoxy-1-methyl-1,2,3,4-tetrahydroisoquinolinium
Description:
(1R)-6,7-diethoxy-1-methyl-1,2,3,4-tetrahydroisoquinolinium is a chemical compound characterized by its tetrahydroisoquinoline structure, which is a bicyclic compound featuring a nitrogen atom within a saturated ring system. The presence of two ethoxy groups at the 6 and 7 positions contributes to its unique properties, enhancing solubility and potentially influencing its biological activity. The methyl group at the 1 position further modifies its steric and electronic characteristics. This compound is likely to exhibit quaternary ammonium behavior due to the positively charged nitrogen, which can affect its interaction with biological membranes and receptors. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychiatric conditions. Additionally, the compound's specific stereochemistry (1R configuration) may play a crucial role in its pharmacological profile, influencing how it interacts with biological systems. As with many organic compounds, its stability, reactivity, and solubility will depend on environmental conditions such as pH and temperature.
Formula:C14H22NO2
InChI:InChI=1/C14H21NO2/c1-4-16-13-8-11-6-7-15-10(3)12(11)9-14(13)17-5-2/h8-10,15H,4-7H2,1-3H3/p+1/t10-/m1/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
6,7-Diethoxy-1-methyl-1,2,3,4-tetrahydroisoquinoline hydrochloride
CAS:6,7-Diethoxy-1-methyl-1,2,3,4-tetrahydroisoquinoline hydrochloride
Molecular weight:271.78g/mol
