CAS 336195-37-0

4-[(2,5-dichlorophenyl)sulfonyl]butan-2-one

Description:

4-[(2,5-Dichlorophenyl)sulfonyl]butan-2-one, identified by its CAS number 336195-37-0, is an organic compound characterized by its sulfonyl functional group attached to a butanone backbone. This compound features a dichlorophenyl group, which contributes to its chemical properties and potential biological activity. The presence of chlorine atoms on the phenyl ring enhances its lipophilicity and may influence its reactivity and interaction with biological targets. The sulfonyl group typically imparts significant polarity, affecting solubility in various solvents. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its structural features suggest potential applications in drug development, particularly in the design of compounds targeting specific biological pathways. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity. Overall, 4-[(2,5-dichlorophenyl)sulfonyl]butan-2-one represents a unique structure that may offer valuable insights in both synthetic and applied chemistry contexts.

Formula: C₁₀H₁₀Cl₂O₃S

InChI: InChI=1/C10H10Cl2O3S/c1-7(13)4-5-16(14,15)10-6-8(11)2-3-9(10)12/h2-3,6H,4-5H2,1H3

SMILES: CC(=O)CCS(=O)(=O)c1cc(ccc1Cl)Cl

Synonyms:

• 4-(2,5-Dichloro-benzenesulfonyl)-butan-2-one

4-[(2,5-dichlorophenyl)sulfonyl]butan-2-one

CAS: 336195-37-0

Formula: C₁₀H₁₀Cl₂O₃S

Purity: 95.0%

Molecular weight: 281.15

Ref: 10-F313951