CAS 336195-38-1

4-[(3,4-dichlorophenyl)sulfonyl]butan-2-one

Description:

4-[(3,4-Dichlorophenyl)sulfonyl]butan-2-one, identified by its CAS number 336195-38-1, is an organic compound characterized by its sulfonyl functional group attached to a butanone backbone. This compound features a butan-2-one structure, which includes a ketone functional group, and a 3,4-dichlorophenyl group that enhances its chemical reactivity and potential biological activity. The presence of the sulfonyl group contributes to its polar nature, influencing its solubility in various solvents. Typically, compounds like this may exhibit properties such as moderate to high melting and boiling points due to the presence of strong intermolecular forces. Additionally, the dichlorophenyl moiety may impart specific pharmacological properties, making it of interest in medicinal chemistry. The compound's reactivity can be attributed to the electrophilic nature of the sulfonyl group, which may participate in various chemical reactions, including nucleophilic substitutions. Overall, this compound's unique structure and functional groups suggest potential applications in pharmaceuticals or agrochemicals, warranting further investigation into its properties and uses.

Formula: C₁₀H₁₀Cl₂O₃S

InChI: InChI=1/C10H10Cl2O3S/c1-7(13)4-5-16(14,15)8-2-3-9(11)10(12)6-8/h2-3,6H,4-5H2,1H3

SMILES: CC(=O)CCS(=O)(=O)c1ccc(c(c1)Cl)Cl

Synonyms:

• 4-(3,4-Dichloro-benzenesulfonyl)-butan-2-one

4-[(3,4-dichlorophenyl)sulfonyl]butan-2-one

CAS: 336195-38-1

Formula: C₁₀H₁₀Cl₂O₃S

Purity: 95.0%

Molecular weight: 281.15

Ref: 10-F315323