CAS 33631-02-6

3,4-Diamino-2-hydroxypyridine

Description:

3,4-Diamino-2-hydroxypyridine is an organic compound characterized by its pyridine ring, which is substituted with two amino groups and one hydroxyl group. This compound typically appears as a solid and is soluble in water due to the presence of the hydroxyl group, which can form hydrogen bonds. The amino groups contribute to its basicity and potential reactivity, making it a versatile intermediate in organic synthesis. It is often used in the preparation of various pharmaceuticals and agrochemicals. The presence of both amino and hydroxyl groups allows for a range of chemical reactions, including acylation and alkylation. Additionally, 3,4-Diamino-2-hydroxypyridine can exhibit biological activity, which may include antimicrobial or antitumor properties, although specific biological effects can vary based on structural modifications and the context of use. Safety data should be consulted for handling and potential hazards associated with this compound, as with any chemical substance.

Formula: C₇H₆F₃NO₂S

InChI: InChI=1/C7H6F3NO2S/c8-7(9,10)5-2-1-3-6(4-5)14(11,12)13/h1-4H,(H2,11,12,13)

SMILES: c1cc(cc(c1)S(=O)(=O)N)C(F)(F)F

Synonyms:

• 3,4-Diamino-2-pyridinol

3,4-Diamino-2-hydroxypyridine

CAS: 33631-02-6

Formula: C₅H₇N₃O

Purity: 97%

Color and Shape: Solid

Molecular weight: 125.1286

Ref: IN-DA00C70J

3,4-Diamino-1H-pyridin-2-one

CAS: 33631-02-6

3,4-Diamino-1H-pyridin-2-one

Purity: 98%

Molecular weight: 125.13g/mol

Ref: 54-OR15984

3,4-Diaminopyridin-2-ol

CAS: 33631-02-6

Formula: C₅H₇N₃O

Purity: 98%

Molecular weight: 125.131

Ref: 10-F239386