CAS 33631-05-9
:2-Amino-4-hydroxypyridine
Description:
2-Amino-4-hydroxypyridine is an organic compound characterized by its pyridine ring, which features both an amino group (-NH2) and a hydroxyl group (-OH) at the 2 and 4 positions, respectively. This compound is typically a white to light yellow crystalline solid and is soluble in water and various organic solvents, reflecting its polar nature due to the presence of the hydroxyl and amino groups. It exhibits basic properties due to the amino group, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. The compound is of interest in medicinal chemistry and materials science, as it can serve as a building block for synthesizing more complex molecules. Additionally, its structural features may contribute to biological activity, making it a subject of research in pharmacology. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.
Formula:C5H6N2O
InChI:InChI=1/C5H6N2O/c6-5-3-4(8)1-2-7-5/h1-3H,(H3,6,7,8)
SMILES:c1c[nH]c(=N)cc1O
Synonyms:- 2-aminopyridin-4(1H)-one
- 2-Aminopyridin-4-ol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Amino-4-hydroxypyridine, 98%
CAS:Employed as an important intermediate for raw material for organic synthesis, agrochemical, pharmaceutical and dyestuff field This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brandFormula:C5H6N2OPurity:98%Molecular weight:110.122-Amino-4-hydroxypyridine
CAS:2-Amino-4-hydroxypyridine
Formula:C5H6N2OPurity:98%Color and Shape: off-white to brown solidMolecular weight:110.11g/mol2-Amino-4-hydroxypyridine
CAS:2-Amino-4-hydroxypyridine (2AH) is a synthetic, isomeric compound that has been synthesized in two different forms: 3-bromo-5-hydroxypyridine and hydroxy group. 2AH has been shown to be chemically stable at room temperature and pH levels of less than 7. It also withstands the loss of membrane fluidity induced by amides, such as 3-amino-2-bromopyridine. 2AH can be used to synthesize oxindole derivatives, which are found in natural gas, and piperidines. This chemical can also be used for aminations with pyrrole or 2 amino 4 hydroxypyridine.Formula:C5H6N2OPurity:Min. 95%Color and Shape:PowderMolecular weight:110.11 g/mol




