CAS 33632-74-5
:3,4-Dihydro-2H-1,5-benzodioxepin-7-carboxylic acid
Description:
3,4-Dihydro-2H-1,5-benzodioxepin-7-carboxylic acid, with the CAS number 33632-74-5, is a chemical compound characterized by its unique bicyclic structure that includes a dioxepin ring fused to a benzene ring. This compound features a carboxylic acid functional group, which contributes to its acidity and potential reactivity in various chemical reactions. The presence of the dioxepin moiety suggests that it may exhibit interesting properties related to its electron-rich nature, potentially influencing its interactions with other molecules. The compound is likely to be soluble in polar solvents due to the carboxylic acid group, while its aromatic characteristics may impart some degree of hydrophobicity. Additionally, compounds of this type may have applications in pharmaceuticals or materials science, although specific biological activities or uses would depend on further research. Overall, 3,4-Dihydro-2H-1,5-benzodioxepin-7-carboxylic acid represents a structurally intriguing compound with potential utility in various chemical contexts.
Formula:C10H10O4
InChI:InChI=1/C10H10O4/c11-10(12)7-2-3-8-9(6-7)14-5-1-4-13-8/h2-3,6H,1,4-5H2,(H,11,12)
SMILES:C1COc2ccc(cc2OC1)C(=O)O
Synonyms:- 2H-1,5-benzodioxepin-7-carboxylic acid, 3,4-dihydro-
- 3,4-Dihydro-2H-1,5-Benzodioxepine-7-Carboxylic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3,4-Dihydro-2H-1,5-benzodioxepin-7-carboxylic acid, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C10H10O4Purity:98%Color and Shape:Pale brown, PowderMolecular weight:194.193,4-Dihydro-2H-benzo[b][1,4]dioxepine-2-carboxylic acid
CAS:Formula:C10H10O4Purity:95%Color and Shape:SolidMolecular weight:194.1843,4-(Trimethylenedioxy)benzoic acid
CAS:3,4-(Trimethylenedioxy)benzoic acid
Purity:95%Molecular weight:194.18g/mol3,4-Dihydro-2H-benzo[b][1,4]dioxepine-2-carboxylic acid
CAS:Formula:C10H10O4Purity:95.0%Molecular weight:194.186



