CAS 33641-15-5
:1-Methyl-1H-pyrazol-5-ol
Description:
1-Methyl-1H-pyrazol-5-ol, with the CAS number 33641-15-5, is an organic compound characterized by its pyrazole ring structure, which features a methyl group and a hydroxyl group. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols due to the presence of the hydroxyl group. It exhibits properties typical of pyrazole derivatives, including potential biological activity, making it of interest in medicinal chemistry and agricultural applications. The hydroxyl group can participate in hydrogen bonding, influencing its reactivity and interaction with other molecules. Additionally, 1-Methyl-1H-pyrazol-5-ol may serve as a ligand in coordination chemistry, forming complexes with various metal ions. Its stability and reactivity can vary based on environmental conditions, such as pH and temperature. Overall, this compound's unique structure and functional groups contribute to its diverse applications in research and industry.
Formula:C4H6N2O
InChI:InChI=1S/C4H6N2O/c1-6-4(7)2-3-5-6/h2-3,7H,1H3
InChI key:InChIKey=CMXOTACIOGGSNH-UHFFFAOYSA-N
SMILES:OC=1N(C)N=CC1
Synonyms:- 1-Methyl-5-hydroxy-1H-pyrazole
- 1-Methyl-5-hydroxypyrazole
- 1-methyl-1H-pyrazol-5-ol
- 1H-Pyrazol-5-ol, 1-methyl-
- 2-Methyl-2H-pyrazol-3-ol
- 5-Hydroxy-1-methyl-5-pyrazole
- N-Heptyl isocyanate
- Pyrazol-5-ol, 1-methyl-
- 5-Hydroxy-1-methylpyrazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Ref: IN-DA003EH8
1gTo inquire5g22.00€10g26.00€1kg241.00€25g31.00€50g53.00€100g68.00€250g129.00€500g196.00€1-Methyl-1H-pyrazol-5-ol
CAS:1-Methyl-1H-pyrazol-5-olFormula:C4H6N2OPurity:97%Color and Shape: yellow powderMolecular weight:98.10g/mol5-Hydroxy-1-methyl-1H-pyrazole
CAS:Formula:C4H6N2OPurity:>98.0%(GC)Color and Shape:White to Orange to Green powder to crystalMolecular weight:98.115-Hydroxy-1-methyl-1H-pyrazole
CAS:5-Hydroxy-1-methyl-1H-pyrazole is a chemical compound that is used as a reagent, useful intermediate, and fine chemical. It is a versatile building block and can be used in the synthesis of pharmaceuticals, agrochemicals, dyes, and other chemicals. CAS No. 33641-15-5Formula:C4H6N2OPurity:Min. 95%Color and Shape:Off-White PowderMolecular weight:98.1 g/mol1-Methyl-1H-pyrazol-5-ol
CAS:Formula:C4H6N2OPurity:95%Color and Shape:Solid, PowderMolecular weight:98.0485-Hydroxy-1-methylpyrazole
CAS:Controlled ProductApplications A pyrazole derivative used as an intermediate in the preparation of herbicides.
Formula:C4H6N2OColor and Shape:NeatMolecular weight:98.1





