CAS 33646-31-0
:D,L-3-Chloroalanine methyl ester hydrochloride
Description:
D,L-3-Chloroalanine methyl ester hydrochloride is a synthetic amino acid derivative characterized by the presence of a chloro substituent on the beta carbon of the alanine structure. This compound is typically a white to off-white crystalline solid, soluble in water and polar organic solvents, which makes it useful in various biochemical applications. The hydrochloride form indicates that it is a salt, enhancing its stability and solubility. As an amino acid analog, it can participate in peptide synthesis and may serve as a building block in the development of pharmaceuticals or agrochemicals. The presence of the chlorine atom can impart unique reactivity, making it a valuable intermediate in organic synthesis. Additionally, its chirality (D,L designation) suggests that it exists in two enantiomeric forms, which may exhibit different biological activities. Safety data should be consulted for handling, as with many chemical substances, to ensure proper precautions are taken due to potential toxicity or reactivity.
Formula:C4H8ClNO2
InChI:InChI=1/C4H8ClNO2/c1-8-4(7)3(6)2-5/h3H,2,6H2,1H3/t3-/m0/s1
SMILES:COC(=O)[C@H](CCl)N
Synonyms:- methyl 3-chloro-L-alaninate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Methyl 2-amino-3-chloropropanoate hydrochloride
CAS:Formula:C4H9Cl2NO2Purity:96%Color and Shape:SolidMolecular weight:174.0258Methyl 2-Amino-3-Chloropropanoate Hydrochloride
CAS:Methyl 2-Amino-3-Chloropropanoate HydrochloridePurity:99%Molecular weight:174.03g/molMethyl 2-amino-3-chloropropanoate hydrochloride
CAS:<p>Methyl 2-amino-3-chloropropanoate hydrochloride is a useful organic compound for research related to life sciences.</p>Formula:C4H9Cl2NO2Color and Shape:SolidMolecular weight:174.02D,L-b-Chloroalanine Methyl Ester Hydrochloride
CAS:Controlled Product<p>Applications D,L-β-Chloroalanine Methyl Ester Hydrochloride (cas# 33646-31-0) is a compound useful in organic synthesis.<br></p>Formula:C4H8ClNO2·ClHColor and Shape:NeatMolecular weight:174.03Methyl 2-amino-3-chloropropanoate hydrochloride
CAS:Formula:C4H9Cl2NO2Purity:96%Molecular weight:174.02





