CAS 33657-49-7
:Chloromethyl butyrate
Description:
Chloromethyl butyrate is an organic compound characterized by its ester functional group, specifically derived from butyric acid and chloromethyl alcohol. It is typically a colorless to pale yellow liquid with a distinctive odor. The compound is known for its reactivity due to the presence of the chloromethyl group, which can participate in nucleophilic substitution reactions. Chloromethyl butyrate is soluble in organic solvents such as ether and chloroform, but has limited solubility in water. It is primarily used in organic synthesis, particularly in the production of various pharmaceuticals and agrochemicals. Safety considerations are important when handling this compound, as it may pose health risks through inhalation or skin contact, necessitating the use of appropriate personal protective equipment. Additionally, it should be stored in a cool, well-ventilated area away from incompatible substances. Overall, chloromethyl butyrate serves as a versatile intermediate in chemical synthesis, contributing to the development of more complex molecules.
Formula:C5H9ClO2
InChI:InChI=1/C5H9ClO2/c1-2-3-5(7)8-4-6/h2-4H2,1H3
SMILES:CCCC(=O)OCCl
Synonyms:- Butanoic Acid, Chloromethyl Ester
- Chloromethyl Butanoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Chloromethyl Butyrate
CAS:Formula:C5H9ClO2Purity:>98.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:136.58Chloromethyl butanoate
CAS:Chloromethyl butanoatePurity:98%Color and Shape:LiquidMolecular weight:136.58g/molChloromethyl butyrate
CAS:<p>Chloromethyl butyrate (CMB) is an inorganic acid that is widely used as a reactant for the synthesis of organic substances. It reacts with hydrochloric acid to form chloromethyl chloroformate, which then reacts with a nucleophile such as water to form a hydroxyl group. CMB has been shown to inhibit the growth of prostate cancer cells and myeloid leukemia cells. It has also been shown to have antibacterial properties against bacterial strains that are resistant to commonly used antibiotics, including methicillin-resistant Staphylococcus aureus. CMB also inhibits HIV infection by inhibiting reverse transcriptase, an enzyme required for viral replication.</p>Formula:C5H9ClO2Purity:Min. 95%Color and Shape:Clear LiquidMolecular weight:136.58 g/mol



