CAS 33675-75-1
:3-(2-phenylethyl)phenol
Description:
3-(2-Phenylethyl)phenol, with the CAS number 33675-75-1, is an organic compound characterized by its phenolic structure, which consists of a phenol group substituted with a 2-phenylethyl group at the meta position. This compound typically appears as a solid or viscous liquid, depending on its purity and temperature. It is known for its aromatic properties and may exhibit biological activity, making it of interest in various fields, including pharmaceuticals and materials science. The presence of both the phenolic hydroxyl group and the aromatic hydrocarbon moiety contributes to its potential as an antioxidant and in other chemical reactions. Additionally, its solubility characteristics can vary, often being more soluble in organic solvents than in water. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance. Overall, 3-(2-phenylethyl)phenol represents a unique compound with potential applications in diverse chemical and industrial processes.
Formula:C14H14O
InChI:InChI=1/C14H14O/c15-14-8-4-7-13(11-14)10-9-12-5-2-1-3-6-12/h1-8,11,15H,9-10H2
SMILES:c1ccc(cc1)CCc1cccc(c1)O
Synonyms:- 1-(3-Hydroxyphenyl)-2-phenylethane
- Phenol, 3-(2-Phenylethyl)-
- Phenol, m-phenethyl-
- 3-(2-Phenylethyl)phenol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Phenethyl-phenol
CAS:<p>3-Phenethylphenol is a hydrophobic, sterically-interacting compound that binds to molybdenum. It has been shown to inhibit the growth of fungi such as Poria and Coriolus. 3-Phenethylphenol also has functionalities such as peroxide, acetonitrile, and nature. This compound is not soluble in water and must be dissolved in solvents such as acetonitrile or polyvinyl acetate before use. 3-Phenethylphenol has been shown to have chromatographic properties, allowing it to be used as an adsorbent for the separation of organic compounds.</p>Formula:C14H14OPurity:Min. 95%Color and Shape:PowderMolecular weight:198.26 g/mol
