CAS 33676-00-5: Hypophyllanthin
Description:Hypophyllanthin is a naturally occurring compound classified as a flavonoid, specifically a type of phenolic compound. It is primarily extracted from the plant species Phyllanthus amarus, which is known for its medicinal properties. Hypophyllanthin exhibits a range of biological activities, including antioxidant, anti-inflammatory, and hepatoprotective effects, making it of interest in pharmacological research. The compound is characterized by its complex molecular structure, which includes multiple hydroxyl groups that contribute to its reactivity and interaction with biological systems. Hypophyllanthin is soluble in organic solvents and has limited solubility in water, which can influence its bioavailability and therapeutic applications. Research into hypophyllanthin has highlighted its potential in treating liver diseases and its role in traditional medicine, particularly in regions where Phyllanthus species are prevalent. As with many natural compounds, further studies are needed to fully elucidate its mechanisms of action and potential therapeutic uses.
Formula:C24H30O7
InChI:InChI=1S/C24H30O7/c1-25-11-16-8-15-10-20(29-5)23-24(31-13-30-23)22(15)21(17(16)12-26-2)14-6-7-18(27-3)19(9-14)28-4/h6-7,9-10,16-17,21H,8,11-13H2,1-5H3/t16-,17-,21+/m1/s1
InChI key:InChIKey=LBJCUHLNHSKZBW-LZJOCLMNSA-N
SMILES:O(C1=CC=C(C=C1OC)C2C3=C4OCOC4=C(OC)C=C3CC(COC)C2COC)C
- Synonyms:
- Hypophyllanthin
- Naphtho[1,2-d]-1,3-dioxole, 9-(3,4-dimethoxyphenyl)-6,7,8,9-tetrahydro-4-methoxy-7,8-bis(methoxymethyl)-, (7S,8S,9R)-
- Naphtho[1,2-d]-1,3-dioxole, 9-(3,4-dimethoxyphenyl)-6,7,8,9-tetrahydro-4-methoxy-7,8-bis(methoxymethyl)-, (7α,8β,9α)-
- Naphthalene, 1α-(3,4-dimethoxyphenyl)-1,2,3,4-tetrahydro-6-methoxy-2β,3α-bis(methoxymethyl)-7,8-(methylenedioxy)-
- Naphtho[1,2-d]-1,3-dioxole, 9-(3,4-dimethoxyphenyl)-6,7,8,9-tetrahydro-4-methoxy-7,8-bis(methoxymethyl)-, (7R,8R,9S)-rel-
