CAS 336784-82-8
:Calebin A
Description:
Calebin A is a natural compound classified as a flavonoid, specifically a type of chalcone. It is primarily derived from the plant species *Calamus* and exhibits various biological activities, including anti-inflammatory, antioxidant, and potential anticancer properties. The molecular structure of Calebin A features a characteristic chalcone backbone, which contributes to its reactivity and interaction with biological systems. Research has indicated that Calebin A may modulate several signaling pathways, making it a subject of interest in pharmacological studies. Its solubility and stability can vary depending on the solvent and environmental conditions, which is crucial for its application in medicinal chemistry. Additionally, Calebin A's safety profile and bioavailability are important factors to consider in its potential therapeutic use. Overall, Calebin A represents a promising candidate for further investigation in the field of natural product chemistry and drug development.
Formula:C21H20O7
InChI:InChI=1S/C21H20O7/c1-26-19-11-14(4-8-17(19)23)3-7-16(22)13-28-21(25)10-6-15-5-9-18(24)20(12-15)27-2/h3-12,23-24H,13H2,1-2H3/b7-3+,10-6+
InChI key:InChIKey=UYEWRTKHKAVRDI-ASVGJQBISA-N
SMILES:C(=C/C(COC(/C=C/C1=CC(OC)=C(O)C=C1)=O)=O)\C2=CC(OC)=C(O)C=C2
Synonyms:- Calebin A
- 2-Propenoic acid, 3-(4-hydroxy-3-methoxyphenyl)-, (3E)-4-(4-hydroxy-3-methoxyphenyl)-2-oxo-3-butenyl ester, (2E)-
- 2-Propenoic acid, 3-(4-hydroxy-3-methoxyphenyl)-, (3E)-4-(4-hydroxy-3-methoxyphenyl)-2-oxo-3-buten-1-yl ester, (2E)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
