CAS 336818-78-1
:(4R)-1-(tert-butoxycarbonyl)-4-phenyl-L-proline
Description:
(4R)-1-(tert-butoxycarbonyl)-4-phenyl-L-proline, identified by its CAS number 336818-78-1, is a chiral amino acid derivative that plays a significant role in organic synthesis and pharmaceutical applications. This compound features a proline backbone, which is a cyclic amino acid known for its unique structural properties, including the ability to adopt various conformations. The tert-butoxycarbonyl (Boc) group serves as a protective group for the amino functionality, facilitating selective reactions during synthesis. The presence of the phenyl group enhances the compound's hydrophobic characteristics, influencing its solubility and interaction with biological systems. As a chiral molecule, it can exist in two enantiomeric forms, with the (R) configuration being particularly relevant in the context of drug design, as chirality can significantly affect biological activity and pharmacokinetics. Overall, this compound is valuable in the development of peptide-based therapeutics and in studies related to stereochemistry in medicinal chemistry.
Formula:C16H21NO4
InChI:InChI=1/C16H21NO4/c1-16(2,3)21-15(20)17-10-12(9-13(17)14(18)19)11-7-5-4-6-8-11/h4-8,12-13H,9-10H2,1-3H3,(H,18,19)/t12-,13-/m0/s1
SMILES:CC(C)(C)OC(=O)N1C[C@H](C[C@H]1C(=O)O)c1ccccc1
Synonyms:- (4R)-1-(tert-Butoxycarbonyl)-4-phenyl-L-proline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(2S,4R)-1-(tert-Butoxycarbonyl)-4-phenylpyrrolidine-2-carboxylic acid
CAS:Formula:C16H21NO4Purity:95%Color and Shape:SolidMolecular weight:291.3422(2S,4R)-1-[(tert-Butoxy)carbonyl]-4-phenylpyrrolidine-2-carboxylic acid
CAS:(2S,4R)-1-[(tert-Butoxy)carbonyl]-4-phenylpyrrolidine-2-carboxylic acidPurity:95%Molecular weight:291.35g/mol(2S,4R)-1-(tert-Butoxycarbonyl)-4-phenylpyrrolidine-2-carboxylic acid
CAS:Formula:C16H21NO4Purity:95%Color and Shape:SolidMolecular weight:291.347(2S,4R)-Boc-4-phenyl-pyrrolidine-2-carboxylic acid
CAS:(2S,4R)-Boc-4-phenyl-pyrrolidine-2-carboxylic acid is a useful intermediate in the preparation of compounds with a pyrrolidine ring. It has been used as a reagent to convert amines into their corresponding carboxylic acids. The compound has also been used as a building block for other compounds and as an intermediate in the synthesis of more complex compounds. CAS No. 336818-78-1
Formula:C16H21NO4Purity:Min. 95%Color and Shape:PowderMolecular weight:291.34 g/mol



