CAS 3369-39-9

1-(1-Naphthalenyl)-1H-pyrrole-2,5-dione

Description:

1-(1-Naphthalenyl)-1H-pyrrole-2,5-dione, with the CAS number 3369-39-9, is an organic compound characterized by its unique structure, which features a pyrrole ring fused with a naphthalene moiety. This compound exhibits a deep color, often associated with its conjugated system, which can contribute to its potential applications in dyes and pigments. It is known for its stability and can participate in various chemical reactions, including electrophilic substitutions due to the electron-rich nature of the naphthalene ring. The presence of the pyrrole moiety also suggests potential biological activity, as pyrrole derivatives are often explored for their pharmacological properties. Solubility can vary depending on the solvent, but it is generally more soluble in organic solvents than in water. Additionally, the compound's reactivity and properties can be influenced by substituents on the naphthalene ring, making it a versatile building block in organic synthesis and materials science. Overall, 1-(1-Naphthalenyl)-1H-pyrrole-2,5-dione is a compound of interest in both synthetic chemistry and potential applications in various fields.

Formula: C₁₄H₉NO₂

InChI: InChI=1/C14H9NO2/c16-13-8-9-14(17)15(13)12-7-3-5-10-4-1-2-6-11(10)12/h1-9H

SMILES: c1ccc2c(c1)cccc2N1C(=O)C=CC1=O

Synonyms:

• 1-(naphthalen-1-yl)-1H-pyrrole-2,5-dione

1-Naphthalen-1-yl-pyrrole-2,5-dione

CAS: 3369-39-9

Formula: C₁₄H₉NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 223.2268

Ref: IN-DA00BZ8O

1-(Naphth-1-yl)-1H-pyrrole-2,5-dione

CAS: 3369-39-9

1-(Naphth-1-yl)-1H-pyrrole-2,5-dione

Formula: C₁₄H₉NO₂

Purity: ≥95%

Color and Shape: Yellow Solid

Molecular weight: 223.23g/mol

Ref: 54-OR7299

1-Naphthalen-1-yl-pyrrole-2,5-dione

CAS: 3369-39-9

Formula: C₁₄H₉NO₂

Purity: 98%

Molecular weight: 223.231

Ref: 10-F026213