CAS 33693-48-0
:4-(Benzyloxy)-3-methoxybenzyl alcohol
Description:
4-(Benzyloxy)-3-methoxybenzyl alcohol, with the CAS number 33693-48-0, is an organic compound characterized by its aromatic structure, which includes a benzyl alcohol moiety and two substituents on the benzene ring. The presence of a benzyloxy group and a methoxy group contributes to its chemical properties, including its solubility in organic solvents and potential reactivity in various chemical reactions. This compound typically exhibits moderate polarity due to the hydroxyl group, which can engage in hydrogen bonding, enhancing its solubility in polar solvents. Additionally, the methoxy group can influence the electronic properties of the aromatic ring, potentially affecting its reactivity in electrophilic aromatic substitution reactions. The compound may also display biological activity, making it of interest in medicinal chemistry and pharmacology. Its synthesis often involves standard organic reactions such as etherification and reduction processes. Overall, 4-(Benzyloxy)-3-methoxybenzyl alcohol is a versatile compound with applications in research and development within the field of organic chemistry.
Formula:C15H16O3
InChI:InChI=1S/C15H16O3/c1-17-15-9-13(10-16)7-8-14(15)18-11-12-5-3-2-4-6-12/h2-9,16H,10-11H2,1H3
InChI key:InChIKey=PDBXFVPMVYQICB-UHFFFAOYSA-N
SMILES:O(CC1=CC=CC=C1)C2=C(OC)C=C(CO)C=C2
Synonyms:- (3-Methoxy-4-phenylmethoxyphenyl)methanol
- 3-Methoxy-4-(benzyloxy)benzyl alcohol
- 3-Methoxy-4-(phenylmethoxy)benzenemethanol
- Benzenemethanol, 3-methoxy-4-(phenylmethoxy)-
- Benzyl alcohol, 4-(benzyloxy)-3-methoxy-
- NSC 169518
- O-Benzylvanillyl alcohol
- Vanillyl alcohol benzyl ether
- [4-(Benzyloxy)-3-Methoxyphenyl]Methanol
- 4-(Benzyloxy)-3-methoxybenzyl alcohol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Benzyloxy-3-methoxybenzyl alcohol, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C15H16O3Purity:98%Color and Shape:White, Crystals or powder or crystalline powderMolecular weight:244.294-Benzyloxy-3-methoxybenzyl alcohol
CAS:Formula:C15H16O3Purity:95%Color and Shape:SolidMolecular weight:244.2857(4-(Benzyloxy)-3-methoxyphenyl)methanol
CAS:(4-(Benzyloxy)-3-methoxyphenyl)methanolPurity:95%Molecular weight:244.29g/mol



