CAS 33695-57-7

2,3-Dihydro-1H-indene-1-carboxamide

Description:

2,3-Dihydro-1H-indene-1-carboxamide, with the CAS number 33695-57-7, is an organic compound characterized by its bicyclic structure, which includes an indene moiety. This compound features a carboxamide functional group, contributing to its chemical reactivity and potential applications in various fields. Typically, it appears as a solid or liquid depending on the specific conditions, and it is soluble in organic solvents. The presence of the carboxamide group suggests that it may engage in hydrogen bonding, influencing its physical properties such as melting and boiling points. Additionally, 2,3-Dihydro-1H-indene-1-carboxamide may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural features allow for potential modifications, which can lead to derivatives with enhanced properties or activities. As with many organic compounds, safety data should be consulted to understand its handling and toxicity profiles. Overall, this compound represents a versatile structure with implications in both synthetic and applied chemistry.

Formula: C₁₀H₁₁NO

InChI: InChI=1S/C10H11NO/c11-10(12)9-6-5-7-3-1-2-4-8(7)9/h1-4,9H,5-6H2,(H2,11,12)

InChI key: InChIKey=DZGMFITYAJIDHR-UHFFFAOYSA-N

SMILES: C(N)(=O)C1C=2C(CC1)=CC=CC2

Synonyms:

• 1-Indancarboxamide
• 1H-Indene-1-carboxamide, 2,3-dihydro-
• 2,3-dihydro-1H-indene-1-carboxamide
• Indan-1-carboxamide

indan-1-carboxamide

CAS: 33695-57-7

Formula: C₁₀H₁₁NO

Purity: 98%

Molecular weight: 161.2004

Ref: IN-DA00CYTU

2,3-Dihydro-1h-indene-1-carboxamide

CAS: 33695-57-7

2,3-Dihydro-1h-indene-1-carboxamide

Purity: 98%

Molecular weight: 161.2g/mol

Ref: 54-OR1005223

2,3-DIHYDRO-1H-INDENE-1-CARBOXAMIDE

CAS: 33695-57-7

Formula: C₁₀H₁₁NO

Purity: 98%

Molecular weight: 161.204

Ref: 10-F331827

2,3-Dihydro-1H-indene-1-carboxamide

CAS: 33695-57-7

2,3-Dihydro-1H-indene-1-carboxamide is an insecticide that has been shown to have a synergistic effect with pesticides such as chlorpyrifos. The compound binds to the alkylthio group of acetylcholinesterase and prevents it from breaking down acetylcholine at synapses, leading to paralysis and death. It is insoluble in water but soluble in organic solvents, which makes it an ideal pesticide for use in wettable powders. 2,3-Dihydro-1H-indene-1-carboxamide has an alkylthio group that reacts with nitro groups on the surface of insects and causes them to explode. This chemical also contains a mercapto group that inhibits the cholinesterase enzyme by binding to the active site on its active site, preventing it from breaking down acetylcholine at synapses, leading

Formula: C₁₀H₁₁NO

Purity: Min. 95%

Molecular weight: 161.2 g/mol

Ref: 3D-IBA69557