CAS 33704-19-7
:3-(tert-butoxycarbonyl)benzoic acid
Description:
3-(tert-Butoxycarbonyl)benzoic acid is an organic compound characterized by its benzoic acid structure with a tert-butoxycarbonyl (Boc) protecting group at the meta position. This compound typically appears as a white to off-white solid and is soluble in organic solvents such as dichloromethane and ethyl acetate, but has limited solubility in water. The presence of the Boc group provides stability and protects the carboxylic acid functionality during various chemical reactions, making it useful in organic synthesis, particularly in peptide synthesis and other applications where selective protection of functional groups is required. The compound exhibits typical acid properties, including the ability to donate protons in solution, and can participate in various chemical reactions, such as esterification and amidation. Its molecular structure allows for potential interactions with biological systems, making it of interest in medicinal chemistry. Safety data should be consulted for handling, as with all chemical substances, to ensure proper precautions are taken.
Formula:C12H14O4
InChI:InChI=1/C12H14O4/c1-12(2,3)16-11(15)9-6-4-5-8(7-9)10(13)14/h4-7H,1-3H3,(H,13,14)
SMILES:CC(C)(C)OC(=O)c1cccc(c1)C(=O)O
Synonyms:- 1,3-Benzenedicarboxylic acid, mono(1,1-dimethylethyl) ester
- 3-(tert-Butoxycarbonyl)benzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-(TERT-BUTOXYCARBONYL)BENZOICACID
CAS:Formula:C12H14O4Purity:98%Color and Shape:SolidMolecular weight:222.2372mono-(tert-Butyl) isophthalate
CAS:mono-(tert-Butyl) isophthalateFormula:C12H14O4Purity:≥95%Color and Shape: white solidMolecular weight:222.24g/mol3-(tert-Butoxycarbonyl)benzoic acid
CAS:Formula:C12H14O4Purity:95%Color and Shape:SolidMolecular weight:222.243-(tert-Butoxycarbonyl)benzoic acid
CAS:3-(tert-Butoxycarbonyl)benzoic acid is a pro-apoptotic agent that binds to the cytosolic domain of Bcl-xL and Bcl-2, causing the release of cytochrome c from mitochondria. This drug also inhibits the proliferation of tumor cells in culture with an IC50 value of about 2 μM. The crystal structure of 3-(tert-Butoxycarbonyl)benzoic acid has been determined by x-ray crystallography and shows that it has antiproliferative activity. It is an optimized analog for bcl-xl, which could be used as a potential cancer chemotherapeutic agent.Formula:C12H14O4Purity:Min. 95%Molecular weight:222.24 g/mol



