CAS 33709-29-4
:3′,4′,5′-Trihydroxyacetophenone
Description:
3′,4′,5′-Trihydroxyacetophenone, with the CAS number 33709-29-4, is an organic compound characterized by its three hydroxyl (-OH) groups attached to a phenyl ring, specifically at the 3', 4', and 5' positions relative to the acetophenone moiety. This compound exhibits properties typical of polyphenolic compounds, including antioxidant activity due to the presence of multiple hydroxyl groups, which can donate hydrogen atoms to free radicals. It is soluble in polar solvents, reflecting its ability to engage in hydrogen bonding. The presence of the acetophenone structure contributes to its reactivity, allowing it to participate in various chemical reactions, such as oxidation and esterification. Additionally, 3′,4′,5′-Trihydroxyacetophenone may exhibit biological activities, making it of interest in pharmaceutical and cosmetic applications. Its stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in its handling and application. Overall, this compound is notable for its multifunctional properties and potential utility in various fields of research and industry.
Formula:C8H8O4
InChI:InChI=1S/C8H8O4/c1-4(9)5-2-6(10)8(12)7(11)3-5/h2-3,10-12H,1H3
InChI key:InChIKey=IBKQQKPQRYUGBJ-UHFFFAOYSA-N
SMILES:C(C)(=O)C1=CC(O)=C(O)C(O)=C1
Synonyms:- 1,2,3-Trihydroxy-5-acetylbenzene
- 1-(3,4,5-Trihydroxyphenyl)ethan-1-one
- 3′,4′,5′-Trihydroxyacetophenone
- Acetophenone, 3′,4′,5′-trihydroxy-
- Ethanone, 1-(3,4,5-Trihydroxyphenyl)-
- 1-(3,4,5-Trihydroxyphenyl)ethanone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Ethanone,1-(3,4,5-trihydroxyphenyl)-
CAS:Formula:C8H8O4Purity:95%Color and Shape:SolidMolecular weight:168.14673,4,5-Trihydroxyacetophenone
CAS:3,4,5-Trihydroxyacetophenone is an organic compound that has been found to be a potent inhibitor of protein synthesis. It has also been shown to inhibit the production of phenolic compounds and other secondary metabolites in plants. This substance can be prepared by electrospray ionization in solution and is used as a chemical probe for investigating protein synthesis. 3,4,5-Trihydroxyacetophenone has been shown to bind with ferrous ions, which would explain its magnetic properties. This chemical can also be titrated calorimetrically and it exhibits sequence specificity in its inhibition activity.
Formula:C8H8O4Purity:Min. 95%Color and Shape:PowderMolecular weight:168.15 g/mol


