CAS 3371-27-5: (-)-Gallocatechin
Description:(-)-Gallocatechin is a naturally occurring flavonoid, specifically a type of catechin, which is predominantly found in various plants, particularly in green tea and certain fruits. It is characterized by its polyphenolic structure, which contributes to its antioxidant properties. The compound has a molecular formula that reflects its complex arrangement of carbon, hydrogen, and oxygen atoms, typically featuring multiple hydroxyl groups that enhance its reactivity and solubility in water. (-)-Gallocatechin exhibits various biological activities, including potential anti-inflammatory, anti-cancer, and cardiovascular protective effects, making it of interest in nutritional and pharmaceutical research. Its stereochemistry, indicated by the prefix "(-)", denotes its specific spatial arrangement, which is crucial for its biological activity. The compound is often studied for its role in human health and its potential therapeutic applications, particularly in the context of chronic diseases linked to oxidative stress. Overall, (-)-Gallocatechin is a significant compound in the field of natural products and health sciences.
Formula:C15H14O7
InChI:InChI=1S/C15H14O7/c16-7-3-9(17)8-5-12(20)15(22-13(8)4-7)6-1-10(18)14(21)11(19)2-6/h1-4,12,15-21H,5H2/t12-,15+/m1/s1
InChI key:InChIKey=XMOCLSLCDHWDHP-DOMZBBRYSA-N
SMILES:OC=1C=C(O)C2=C(OC(C3=CC(O)=C(O)C(O)=C3)C(O)C2)C1
- Synonyms:
- (-)-Gallocatechol
- (2S,3R)-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol
- (2S,3R)-3,4-Dihydro-2-(3,4,5-trihydroxyphenyl)-2H-1-benzopyran-3,5,7-triol
- 2H-1-Benzopyran-3,5,7-triol, 3,4-dihydro-2-(3,4,5-trihydroxyphenyl)-, (2S,3R)-
- 2H-1-Benzopyran-3,5,7-triol, 3,4-dihydro-2-(3,4,5-trihydroxyphenyl)-, (2S-trans)-
- l-Gallocatechin
- (-)-Gallocatechin
- (-)-Gallocatechin
