
CAS 3371-56-0
:14-Hydroxymorphine
Description:
14-Hydroxymorphine is an organic compound that belongs to the class of morphine derivatives, specifically classified as an opioid. It is characterized by the presence of a hydroxyl (-OH) group at the 14-position of the morphine structure, which influences its pharmacological properties. This compound exhibits analgesic effects, similar to other opioids, and is of interest in medicinal chemistry for its potential therapeutic applications. The molecular formula of 14-hydroxymorphine reflects its complex structure, which includes multiple rings and functional groups typical of alkaloids derived from the opium poppy. Its solubility, stability, and interaction with opioid receptors are key factors that determine its efficacy and safety profile. Additionally, 14-hydroxymorphine may undergo metabolic transformations in the body, affecting its bioavailability and duration of action. As with other opioids, there are considerations regarding its potential for abuse and dependence, necessitating careful regulation and research into its clinical use.
Formula:C17H19NO4
InChI:InChI=1S/C17H19NO4/c1-18-7-6-16-13-9-2-3-10(19)14(13)22-15(16)11(20)4-5-17(16,21)12(18)8-9/h2-5,11-12,15,19-21H,6-8H2,1H3/t11-,12+,15-,16-,17+/m0/s1
InChI key:InChIKey=WYMBHLXUDPDGQJ-BRJGLHKUSA-N
SMILES:O[C@]12[C@@]34C=5C(O[C@]3([C@@H](O)C=C1)[H])=C(O)C=CC5C[C@]2(N(C)CC4)[H]
Synonyms:- Morphine, 14-hydroxy-
- 14-Hydroxymorphine
- Morphinan-2,6α,14-triol, 7,8-didehydro-4,5α-epoxy-17-methyl-
- (5α,6α)-7,8-Didehydro-4,5-epoxy-17-methylmorphinan-3,6,14-triol
- Morphinan-3,6,14-triol, 7,8-didehydro-4,5-epoxy-17-methyl-, (5α,6α)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
14-Hydroxymorphine
CAS:Controlled ProductFormula:C17H19NO4Color and Shape:NeatMolecular weight:301.337
