Methyl 1-oxaspiro[2.5]octane-2-carboxylate, identified by its CAS number 33717-87-2, is a chemical compound characterized by its unique spirocyclic structure, which features a bicyclic framework with an ester functional group. This compound typically exhibits a moderate level of polarity due to the presence of the carboxylate moiety, which can influence its solubility in various organic solvents. The spiro structure contributes to its rigidity, potentially affecting its reactivity and interaction with other molecules. Methyl 1-oxaspiro[2.5]octane-2-carboxylate may be of interest in synthetic organic chemistry, particularly in the development of pharmaceuticals or agrochemicals, due to its potential as a building block in complex molecular architectures. Additionally, its unique structural features may impart specific biological activities, making it a candidate for further research in medicinal chemistry. As with many organic compounds, safety and handling precautions should be observed, as the compound may possess certain hazards associated with its chemical nature.

C9H14O3 - InChI=1/C9H14O3/c1-11-8(10)7-9(12-7)5-3-2-4-6-9/h7H,2-6H2,1H3

methyl 1-oxaspiro[2.5]octane-2-carboxylate

33717-87-2: Methyl 1-oxaspiro[2.5]octane-2-carboxylate, identified by its CAS number 33717-87-2, is a chemical compound characterized by its unique spirocyclic structure, which features a bicyclic framework with an ester functional group. This compound typically exhibits a moderate level of polarity due to the presence of the carboxylate moiety, which can influence its solubility in various organic solvents. The spiro structure contributes to its rigidity, potentially affecting its reactivity and interaction with other molecules. Methyl 1-oxaspiro[2.5]octane-2-carboxylate may be of interest in synthetic organic chemistry, particularly in the development of pharmaceuticals or agrochemicals, due to its potential as a building block in complex molecular architectures. Additionally, its unique structural features may impart specific biological activities, making it a candidate for further research in medicinal chemistry. As with many organic compounds, safety and handling precautions should be observed, as the compound may possess certain hazards associated with its chemical nature.

CAS 33717-87-2

methyl 1-oxaspiro[2.5]octane-2-carboxylate

Methyl 1-oxaspiro[2.5]octane-2-carboxylate

Ref: 3D-IBA71787