CAS 33718-15-9
:1-bromo-8-fluoronaphthalene
Description:
1-Bromo-8-fluoronaphthalene is an organic compound characterized by the presence of both bromine and fluorine substituents on a naphthalene ring system. Specifically, the bromine atom is located at the first position, while the fluorine atom is at the eighth position of the naphthalene structure. This compound is typically a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is known for its relatively high stability and can participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. The presence of the bromine and fluorine atoms influences its reactivity and solubility, making it useful in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. Additionally, 1-bromo-8-fluoronaphthalene may exhibit interesting electronic properties due to the halogen substituents, which can affect its behavior in electronic applications. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C10H6BrF
InChI:InChI=1/C10H6BrF/c11-8-5-1-3-7-4-2-6-9(12)10(7)8/h1-6H
SMILES:c1cc2cccc(c2c(c1)Br)F
Synonyms:- Naphthalene, 1-Bromo-8-Fluoro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Naphthalene, 1-bromo-8-fluoro-
CAS:Formula:C10H6BrFPurity:98%Color and Shape:SolidMolecular weight:225.05701-Bromo-8-fluoronaphthalene
CAS:<p>1-Bromo-8-fluoronaphthalene is a versatile compound that has various applications in the field of research and medicine. It is commonly used as a building block for the synthesis of different compounds, including misoprostol, a medication used to prevent stomach ulcers. Additionally, 1-Bromo-8-fluoronaphthalene has been found to enhance the growth factor effect of allopregnanolone, a neurosteroid with potential therapeutic benefits.</p>Formula:C10H6BrFPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:225.06 g/mol
