CAS 33725-54-1

Tris[3-(hydroxy-κO)-2-methyl-4H-pyran-4-onato-κO4]iron

Description:

Tris[3-(hydroxy-κO)-2-methyl-4H-pyran-4-onato-κO4]iron, identified by its CAS number 33725-54-1, is a coordination compound featuring iron as the central metal ion coordinated to three bidentate ligands derived from 3-hydroxy-2-methyl-4H-pyran-4-one. This compound exhibits characteristics typical of metal complexes, including distinct color properties, which can vary based on the oxidation state of the iron and the ligands' arrangement. The presence of hydroxyl groups in the ligands contributes to the compound's solubility and potential reactivity in various solvents. Additionally, the chelating nature of the ligands enhances the stability of the complex, making it less prone to dissociation in solution. Such compounds are often studied for their potential applications in fields like catalysis, materials science, and medicinal chemistry, particularly due to their ability to form stable complexes with various substrates. The specific structural and electronic properties of this compound can influence its behavior in chemical reactions and interactions with biological systems.

Formula: C₁₈H₁₅FeO₉

InChI: InChI=1S/3C6H6O3.Fe/c3*1-4-6(8)5(7)2-3-9-4;/h3*2-3,8H,1H3;/q;;;+3/p-3

InChI key: InChIKey=AHPWLYJHTFAWKI-UHFFFAOYSA-K

SMILES: CC1=C2[O-][Fe+3]34([O-]C=5C(=O3)C=COC5C)([O-]C=6C(=O4)C=COC6C)O=C2C=CO1

Synonyms:

• Iron, tris[3-(hydroxy-κO)-2-methyl-4H-pyran-4-onato-κO4]-
• 4H-Pyran-4-one, 3-hydroxy-2-methyl-, iron complex
• Tris[3-(hydroxy-κO)-2-methyl-4H-pyran-4-onato-κO4]iron
• Iron, tris(3-hydroxy-2-methyl-4H-pyran-4-onato-O3,O4)-
• Iron, tris(3-hydroxy-2-methyl-4H-pyran-4-onato)-

Iron, tris[3-(hydroxy-kO)-2-methyl-4H-pyran-4-onato-kO4]-

CAS: 33725-54-1

Formula: C₁₈H₁₅FeO₉

Purity: 97%

Color and Shape: Solid

Molecular weight: 431.1513

Ref: IN-DA007IX3

Iron(III) 2-methyl-4-oxo-4H-pyran-3-olate

CAS: 33725-54-1

Iron(III) 2-methyl-4-oxo-4H-pyran-3-olate

Purity: 99%

Molecular weight: 431.15g/mol

Ref: 54-IN10491

Ferric maltol

CAS: 33725-54-1

Ferric maltol

Purity: ≥98%

Molecular weight: 431.15g/mol

Ref: 54-BUP04867

Ferric maltol

CAS: 33725-54-1

Ferric maltol is a non-salt oral iron with better tolerance for those intolerant to other iron forms.

Formula: C₁₈H₁₅FeO₉

Purity: 98.68%

Color and Shape: Solid

Molecular weight: 431.15

Ref: TM-T13692