CAS 33741-78-5
:(2R)-amino(naphthalen-2-yl)ethanoic acid
Description:
(2R)-Amino(naphthalen-2-yl)ethanoic acid, also known as L-tyrosine, is an aromatic amino acid characterized by its structure, which includes a naphthalene ring and an amino group attached to a two-carbon ethanoic acid backbone. This compound is a non-essential amino acid, meaning that it can be synthesized by the body from phenylalanine. It plays a crucial role in the biosynthesis of neurotransmitters such as dopamine, norepinephrine, and epinephrine, making it vital for proper neurological function. The presence of the naphthalene moiety contributes to its hydrophobic characteristics, influencing its solubility and interaction with biological membranes. L-tyrosine is also involved in the production of melanin, the pigment responsible for coloration in skin and hair. In terms of physical properties, it typically appears as a white crystalline solid and is soluble in water, with its solubility being influenced by pH. Its applications extend to nutritional supplements, pharmaceuticals, and research in neurobiology and metabolic disorders.
Formula:C12H11NO2
InChI:InChI=1/C12H11NO2/c13-11(12(14)15)10-6-5-8-3-1-2-4-9(8)7-10/h1-7,11H,13H2,(H,14,15)/t11-/m1/s1
SMILES:c1ccc2cc(ccc2c1)[C@H](C(=O)O)N
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Amino-naphthalen-2-yl-acetic acid
CAS:Formula:C12H11NO2Purity:97%Color and Shape:SolidMolecular weight:201.2212Amino-naphthalen-2-yl-acetic acid
CAS:Amino-naphthalen-2-yl-acetic acidPurity:95%Molecular weight:201.22g/molAmino(naphthalen-2-yl)acetic acid
CAS:Amino(naphthalen-2-yl)acetic acid is a versatile chemical building block that can be used in research, industry and as a high quality reagent. It is a useful scaffold for the synthesis of complex compounds. Amino(naphthalen-2-yl)acetic acid has been shown to be an excellent reactant for the production of fine chemicals and is high quality, with a purity of 99%. This product is also used as a speciality chemical for the production of pharmaceuticals, pesticides, and other chemical products.
Formula:C12H11NO2Purity:Min. 95%Color and Shape:PowderMolecular weight:201.22 g/mol2-Amino-2-(naphthalen-2-yl)acetic acid
CAS:Formula:C12H11NO2Purity:95%Color and Shape:SolidMolecular weight:201.225



