CymitQuimica logo

CAS 337457-78-0

:

3,4-Dihydro-3-[(3-pyridinylmethyl)amino]-6-[1,2,2,2-tetrafluoro-1-(trifluoromethyl)ethyl]-2(1H)-quinazolinone

Description:
3,4-Dihydro-3-[(3-pyridinylmethyl)amino]-6-[1,2,2,2-tetrafluoro-1-(trifluoromethyl)ethyl]-2(1H)-quinazolinone is a synthetic organic compound characterized by its complex structure, which includes a quinazolinone core, a pyridinylmethyl amino group, and a tetrafluoroethyl substituent. This compound typically exhibits properties such as moderate to high lipophilicity due to the presence of fluorinated groups, which can enhance its bioavailability and interaction with biological targets. The presence of the quinazolinone moiety suggests potential pharmacological activity, as many compounds in this class are known for their roles in medicinal chemistry, particularly as kinase inhibitors or in cancer therapy. Additionally, the fluorinated groups may impart unique electronic properties, influencing the compound's reactivity and stability. Its solubility characteristics may vary depending on the solvent, and it may exhibit specific interactions with biological macromolecules, making it a candidate for further investigation in drug development. Overall, this compound's unique structural features contribute to its potential applications in pharmaceuticals.
Formula:C17H13F7N4O
InChI:InChI=1S/C17H13F7N4O/c18-15(16(19,20)21,17(22,23)24)12-3-4-13-11(6-12)9-28(14(29)27-13)26-8-10-2-1-5-25-7-10/h1-7,26H,8-9H2,(H,27,29)
InChI key:InChIKey=HCTLNRAMSIZVOR-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(C(F)(F)F)(F)C=1C=C2C(=CC1)NC(=O)N(NCC=3C=CC=NC3)C2
Synonyms:
  • 2(1H)-Quinazolinone, 3,4-dihydro-3-[(3-pyridinylmethyl)amino]-6-[1,2,2,2-tetrafluoro-1-(trifluoromethyl)ethyl]-
  • 3,4-Dihydro-3-[(3-pyridinylmethyl)amino]-6-[1,2,2,2-tetrafluoro-1-(trifluoromethyl)ethyl]-2(1H)-quinazolinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.