CAS 337463-88-4

6-Bromo-2H-pyrido[3,2-b][1,4]oxazin-3(4H)-one

Description:

6-Bromo-2H-pyrido[3,2-b][1,4]oxazin-3(4H)-one is a heterocyclic compound characterized by its unique bicyclic structure that incorporates both a pyridine and an oxazine ring. The presence of a bromine atom at the 6-position contributes to its reactivity and potential applications in medicinal chemistry. This compound typically exhibits properties such as moderate solubility in organic solvents and stability under standard laboratory conditions. Its molecular structure suggests potential biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. The oxazinone moiety may also impart specific interactions with biological targets, enhancing its utility in drug design. As with many heterocycles, the compound's properties can be influenced by substituents and the overall electronic environment, which can affect its reactivity and interaction with other molecules. Overall, 6-Bromo-2H-pyrido[3,2-b][1,4]oxazin-3(4H)-one represents a valuable scaffold for further exploration in chemical and biological research.

Formula: C₇H₅BrN₂O₂

InChI: InChI=1/C7H5BrN2O2/c8-5-2-1-4-7(9-5)10-6(11)3-12-4/h1-2H,3H2,(H,9,10,11)

SMILES: c1cc(Br)nc2c1OCC(=N2)O

Synonyms:

• 2H-pyrido[3,2-b]-1,4-oxazin-3(4H)-one, 6-bromo-

6-Bromo-2H-pyrido[3,2-b][1,4]oxazin-3(4H)-one

CAS: 337463-88-4

Formula: C₇H₅BrN₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 229.0308

Ref: IN-DA00CIT9

6-Bromo-2H-pyrido[3,2-b][1,4]oxazin-3(4H)-one

CAS: 337463-88-4

6-Bromo-2H-pyrido[3,2-b][1,4]oxazin-3(4H)-one

Purity: 99%

Molecular weight: 229.03g/mol

Ref: 54-OR94456

6-Bromo-2H-pyrido[3,2-b][1,4]oxazin-3(4H)-one

CAS: 337463-88-4

6-Bromo-2H-pyrido[3,2-b][1,4]oxazin-3(4H)-one is a versatile building block that can be used in a variety of chemical reactions as an intermediate. It is also useful in the synthesis of a variety of compounds, such as pharmaceuticals and research chemicals. 6-Bromo-2H-pyrido[3,2-b][1,4]oxazin-3(4H)-one is an organic compound with a molecular formula of C8H5BrN4O. It has an mp of 152°C and decomposes to form nitrogen gas and carbon monoxide at higher temperatures.

Formula: C₇H₅BrN₂O₂

Purity: Min. 95%

Color and Shape: Solid

Molecular weight: 229.03 g/mol

Ref: 3D-FB144104

6-Bromo-2H-pyrido[3,2-b][1,4]oxazin-3(4H)-one

CAS: 337463-88-4

Formula: C₇H₅BrN₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 229.033

Ref: 10-F222180