CAS 337487-15-7

5-(4-bromophenyl)-4-ethyl-4H-1,2,4-triazole-3-thiol

Description:

5-(4-Bromophenyl)-4-ethyl-4H-1,2,4-triazole-3-thiol is a chemical compound characterized by its unique triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features a bromophenyl group, which contributes to its potential reactivity and biological activity. The presence of the thiol (-SH) functional group enhances its ability to form bonds with metals and participate in redox reactions, making it of interest in various fields, including medicinal chemistry and materials science. The ethyl group attached to the triazole ring can influence the compound's solubility and lipophilicity, affecting its pharmacokinetic properties. Additionally, the bromine atom can serve as a site for further chemical modifications, potentially leading to derivatives with enhanced activity. Overall, this compound's structural features suggest it may exhibit interesting biological properties, warranting further investigation for applications in drug development or as a chemical probe in biological research.

Formula: C₁₀H₁₀BrN₃S

InChI: InChI=1/C10H10BrN3S/c1-2-14-9(12-13-10(14)15)7-3-5-8(11)6-4-7/h3-6H,2H2,1H3,(H,13,15)

SMILES: CCn1c(c2ccc(cc2)Br)nnc1S

Synonyms:

• 4H-1,2,4-triazole-3-thiol, 5-(4-bromophenyl)-4-ethyl-

5-(4-bromophenyl)-4-ethyl-4H-1,2,4-triazole-3-thiol

CAS: 337487-15-7

Formula: C₁₀H₁₀BrN₃S

Purity: 95.0%

Molecular weight: 284.18

Ref: 10-F307708