CAS 337489-46-0

[(5-ethyl-5H-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]acetic acid

Description:

The chemical substance known as [(5-ethyl-5H-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]acetic acid, with the CAS number 337489-46-0, is a complex organic compound characterized by its unique structural features. It contains a triazinoindole moiety, which contributes to its potential biological activity. The presence of a sulfanyl group indicates that it has a thiol functional group, which can participate in various chemical reactions, including nucleophilic substitutions and redox reactions. The acetic acid component suggests that it has acidic properties, allowing it to act as a proton donor in chemical reactions. This compound may exhibit interesting pharmacological properties due to its structural diversity, making it a subject of interest in medicinal chemistry. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other chemical species. Overall, this compound's unique characteristics make it a valuable candidate for further research in drug development and other applications in chemistry and biochemistry.

Formula: C₁₃H₁₂N₄O₂S

InChI: InChI=1/C13H12N4O2S/c1-2-17-9-6-4-3-5-8(9)11-12(17)14-13(16-15-11)20-7-10(18)19/h3-6H,2,7H2,1H3,(H,18,19)

SMILES: CCn1c2ccccc2c2c1nc(nn2)SCC(=O)O

Synonyms:

• acetic acid, 2-[(5-ethyl-5H-1,2,4-triazino[5,6-b]indol-3-yl)thio]-

[(5-ethyl-5H-[1,2,4]triazino[5,6-b]indol-3-yl)thio]acetic acid

CAS: 337489-46-0

Purity: 95.0%

Molecular weight: 288.3299865722656

Ref: 10-F314626