CAS 337497-09-3

4-[(2,3-dihydro-1,4-benzodioxin-2-ylmethyl)amino]-4-oxobutanoic acid

Description:

4-[(2,3-dihydro-1,4-benzodioxin-2-ylmethyl)amino]-4-oxobutanoic acid, identified by its CAS number 337497-09-3, is a chemical compound characterized by its complex structure, which includes a benzodioxin moiety and an amino acid derivative. This compound features a butanoic acid backbone with a ketone functional group and an amino group, contributing to its potential biological activity. The presence of the benzodioxin ring suggests possible interactions with biological targets, making it of interest in medicinal chemistry. Its molecular structure indicates that it may exhibit properties such as solubility in polar solvents and potential reactivity due to the functional groups present. The compound's unique characteristics may allow for applications in pharmaceuticals, particularly in the development of drugs targeting specific pathways or conditions. However, detailed studies on its pharmacokinetics, toxicity, and efficacy would be necessary to fully understand its potential uses and safety profile.

Formula: C₁₃H₁₅NO₅

InChI: InChI=1/C13H15NO5/c15-12(5-6-13(16)17)14-7-9-8-18-10-3-1-2-4-11(10)19-9/h1-4,9H,5-8H2,(H,14,15)(H,16,17)

SMILES: c1ccc2c(c1)OCC(CN=C(CCC(=O)O)O)O2

Synonyms:

• Butanoic acid, 4-[[(2,3-dihydro-1,4-benzodioxin-2-yl)methyl]amino]-4-oxo-
• 4-[(2,3-Dihydro-1,4-benzodioxin-2-ylmethyl)amino]-4-oxobutanoic acid

4-[(2,3-dihydro-1,4-benzodioxin-2-ylmethyl)amino]-4-oxobutanoic acid

CAS: 337497-09-3

Formula: C₁₃H₁₅NO₅

Purity: 95.0%

Molecular weight: 265.265

Ref: 10-F315055