CAS 337508-70-0

[5-(2-methyl-1,3-thiazol-4-yl)-2-thienyl]methanol

Description:

[5-(2-methyl-1,3-thiazol-4-yl)-2-thienyl]methanol is an organic compound characterized by its unique structural features, which include a thiazole ring and a thienyl group. The presence of these heterocycles contributes to its potential biological activity and chemical reactivity. The thiazole moiety, known for its role in various pharmacological applications, often exhibits properties such as antimicrobial and antifungal activities. The thienyl group adds to the compound's aromatic character, which can influence its solubility and interaction with biological targets. As a methanol derivative, it contains a hydroxyl (-OH) functional group, which can participate in hydrogen bonding, enhancing its solubility in polar solvents. This compound may be of interest in medicinal chemistry and material science due to its potential applications in drug development and organic synthesis. Its specific properties, such as melting point, boiling point, and spectral characteristics, would require experimental determination or literature reference for precise values.

Formula: C₉H₉NOS₂

InChI: InChI=1/C9H9NOS2/c1-6-10-8(5-12-6)9-3-2-7(4-11)13-9/h2-3,5,11H,4H2,1H3

SMILES: Cc1nc(cs1)c1ccc(CO)s1

Synonyms:

• [5-(2-Methyl-1,3-Thiazol-4-Yl)Thiophen-2-Yl]Methanol

(5-(2-Methylthiazol-4-yl)thiophen-2-yl)methanol

CAS: 337508-70-0

Purity: 98%

Molecular weight: 211.3000031

Ref: 10-F754001

[5-(2-Methyl-1,3-thiazol-4-yl)-2-thienyl]methanol

Controlled Product

CAS: 337508-70-0

Applications [5-(2-Methyl-1,3-thiazol-4-yl)-2-thienyl]methanol (cas# 337508-70-0) is a useful research chemical for chemoselective green preparation of nitriles using non-noble metal oxide-based nanocatalysts.
References Jagadeesh, R., et al.: Nat. Commun., 5, 4123 (2014)

Formula: C₉H₉NOS₂

Color and Shape: Neat

Molecular weight: 211.3

Ref: TR-M695720