CAS 337515-55-6
:6,10-Methanobenzocyclodecene-3,11-diol, 1,2,3,4,4a,5,6,7,8,11,12,12a-dodecahydro-9,12a,13,13-tetramethyl-4-methylene-, 3-acetate, (3S,4aS,6S,11S,12aS)-
Description:
6,10-Methanobenzocyclodecene-3,11-diol, with the CAS number 337515-55-6, is a complex organic compound characterized by its unique bicyclic structure that includes a methanobenzocyclodecene framework. This compound features multiple stereocenters, contributing to its chiral nature, which can influence its biological activity and interactions. The presence of hydroxyl (–OH) groups indicates that it may exhibit properties typical of alcohols, such as hydrogen bonding capabilities, which can affect its solubility and reactivity. Additionally, the acetate functional group suggests potential for esterification reactions. The compound's dodecahydro structure implies a high degree of saturation, which generally enhances stability and reduces reactivity compared to unsaturated compounds. Its specific stereochemistry, denoted by the (3S,4aS,6S,11S,12aS) configuration, is crucial for determining its three-dimensional shape and, consequently, its interactions in biological systems. Overall, this compound's intricate structure and functional groups suggest potential applications in fields such as pharmaceuticals or materials science, although specific applications would depend on further research and characterization.
Formula:C22H34O3
InChI:InChI=1S/C22H34O3/c1-13-7-8-16-11-17-14(2)19(25-15(3)23)9-10-22(17,6)12-18(24)20(13)21(16,4)5/h16-19,24H,2,7-12H2,1,3-6H3/t16-,17+,18-,19-,22-/m0/s1
InChI key:InChIKey=BMPKIAPYMZISRD-PQTWGXLHSA-N
SMILES:C[C@@]12[C@](C[C@]3(C(C)(C)C([C@@H](O)C1)=C(C)CC3)[H])(C(=C)[C@@H](OC(C)=O)CC2)[H]
Synonyms:- 6,10-Methanobenzocyclodecene-3,11-diol, 1,2,3,4,4a,5,6,7,8,11,12,12a-dodecahydro-9,12a,13,13-tetramethyl-4-methylene-, 3-acetate, (3S,4aS,6S,11S,12aS)-
- Taxa-4(20),11(12)-dien-5α-acetoxy-10β-ol
- Taxadiene-5-α-acetate-10-β-ol
- 5α-Acetoxytaxa-4(20),11(12)-dien-10β-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Ref: 4Z-P-2855
Discontinued product

