CAS 337535-82-7
:N-(3-bromobenzyl)acetamide
Description:
N-(3-bromobenzyl)acetamide is an organic compound characterized by its amide functional group, which is derived from acetic acid and a 3-bromobenzyl moiety. This compound typically appears as a solid or crystalline substance and is known for its potential applications in medicinal chemistry and as a building block in organic synthesis. The presence of the bromine atom in the benzyl group enhances its reactivity and can influence its biological activity. The amide linkage contributes to its stability and solubility in various organic solvents. N-(3-bromobenzyl)acetamide may exhibit properties such as moderate polarity, which can affect its interactions in biological systems. Additionally, the compound's structure suggests potential for hydrogen bonding due to the amide group, which can play a role in its reactivity and interactions with other molecules. As with many organic compounds, safety precautions should be taken when handling N-(3-bromobenzyl)acetamide, as it may pose health risks if ingested or inhaled.
Formula:C9H10BrNO
InChI:InChI=1/C9H10BrNO/c1-7(12)11-6-8-3-2-4-9(10)5-8/h2-5H,6H2,1H3,(H,11,12)
SMILES:CC(=NCc1cccc(c1)Br)O
Synonyms:- acetamide, N-[(3-bromophenyl)methyl]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
N-(3-Bromobenzyl)acetamide
CAS:Formula:C9H10BrNOPurity:%Color and Shape:SolidMolecular weight:228.0858N-(3-Bromobenzyl)acetamide
CAS:N-(3-Bromobenzyl)acetamide is a chemical that has been used in the synthesis of natural products. It is a synthetic intermediate that can be used to synthesize new compounds. This compound can be used as a reactant in the amidation reaction of aromatic compounds with amines, and as an intermediate in the synthesis of heterocyclic compounds. It is also used as a palladium catalyst for certain reactions, such as the synthesis of peptides by lipase-catalyzed reactions. N-(3-Bromobenzyl)acetamide can be synthesized by reacting benzyl bromide with acetamide and then reacting it with sodium hydroxide.
Formula:C9H10BrNOPurity:Min. 95%Molecular weight:228.09 g/mol



