CAS 337536-14-8

Methyl 3-bromo-2-bromomethylbenzoate

Description:

Methyl 3-bromo-2-bromomethylbenzoate is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with bromine and a methoxycarbonyl group (the ester functional group). The presence of multiple bromine atoms indicates that it is a halogenated compound, which can influence its reactivity and physical properties, such as solubility and boiling point. The methyl ester group contributes to its potential as a building block in organic synthesis, particularly in the preparation of more complex molecules. This compound may exhibit biological activity due to the presence of bromine, which can enhance its interaction with biological targets. Additionally, its structure suggests that it may participate in electrophilic aromatic substitution reactions, making it a useful intermediate in the synthesis of pharmaceuticals or agrochemicals. Safety considerations should be taken into account when handling this compound, as brominated compounds can be hazardous. Overall, Methyl 3-bromo-2-bromomethylbenzoate is a versatile compound with applications in various fields of chemistry.

Formula: C₉H₈Br₂O₂

InChI: InChI=1/C9H8Br2O2/c1-13-9(12)6-3-2-4-8(11)7(6)5-10/h2-4H,5H2,1H3

SMILES: COC(=O)c1cccc(c1CBr)Br

Synonyms:

• 3-Bromo-2-bromomethylbenzoic acid methyl ester

Methyl 3-bromo-2-bromomethylbenzoate

CAS: 337536-14-8

Formula: C₉H₈Br₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 307.9666

Ref: IN-DA00C66Y

Methyl 3-bromo-2-(bromomethyl)benzoate

CAS: 337536-14-8

Methyl 3-bromo-2-(bromomethyl)benzoate

Formula: C₉H₈Br₂O₂

Purity: 92%

Color and Shape: yellow liquid

Molecular weight: 307.96662g/mol

Ref: 54-OR400299

Methyl 3-bromo-2-(bromomethyl)benzoate

CAS: 337536-14-8

Formula: C₉H₈Br₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 307.969

Ref: 10-F235196